4-cyano-N-[4-({[8-methyl-2-(methylamino)quinazolin-4-yl]amino}methyl)phenyl]benzamide trifluoroacetate salt

ID: ALA3928449

PubChem CID: 134140848

Max Phase: Preclinical

Molecular Formula: C27H23F3N6O3

Molecular Weight: 422.49

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1nc(NCc2ccc(NC(=O)c3ccc(C#N)cc3)cc2)c2cccc(C)c2n1.O=C(O)C(F)(F)F

Standard InChI:  InChI=1S/C25H22N6O.C2HF3O2/c1-16-4-3-5-21-22(16)30-25(27-2)31-23(21)28-15-18-8-12-20(13-9-18)29-24(32)19-10-6-17(14-26)7-11-19;3-2(4,5)1(6)7/h3-13H,15H2,1-2H3,(H,29,32)(H2,27,28,30,31);(H,6,7)

Standard InChI Key:  ZNENUUSDVKLJOW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
   43.7419  -14.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   43.0369  -13.8768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   43.7419  -15.1026    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   44.4499  -13.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   45.1573  -14.2866    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   44.4506  -13.0602    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   45.1519  -13.4630    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   41.5527  -14.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5527  -13.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8395  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.8395  -12.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5527  -12.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2618  -12.6312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2618  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.2618  -15.0952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   40.8395  -15.0952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.1304  -14.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4213  -15.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7081  -14.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.7081  -13.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.4213  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.1304  -13.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9949  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.2816  -13.8611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.1544  -12.6312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   35.8593  -12.2185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.5725  -12.6312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5725  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8593  -13.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8593  -14.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1544  -15.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4412  -14.6824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.4412  -13.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.1544  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.8593  -11.3972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.5725  -10.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.7279  -13.4525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5527  -11.3972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   41.5527  -10.5758    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  1  4  1  0
  4  5  1  0
  4  6  1  0
  4  7  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
  8 15  2  0
  8 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 25 34  2  0
 29 34  1  0
 35 36  1  0
 26 35  1  0
 33 37  1  0
 24 28  1  0
 23 24  1  0
 20 23  1  0
 16 17  1  0
 38 39  3  0
 12 38  1  0
M  END

Associated Targets(Human)

CTNNB1 Tchem TCF4/beta-catenin (616 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.49Molecular Weight (Monoisotopic): 422.1855AlogP: 4.72#Rotatable Bonds: 6
Polar Surface Area: 102.73Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 6.71CX LogP: 4.83CX LogD: 4.75
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.42Np Likeness Score: -1.63

References

1.  (2009)  Amino-substituted quinazoline derivatives as inhibitors of Beta-catenin/TCF-4 pathway and cancer treatment agents, 

Source