3-(4-methoxyphenyl)-6-methyl-2-(3,4,5-trimethoxybenzylthio)quinazolin-4(3H)-one

ID: ALA3929211

PubChem CID: 134140548

Max Phase: Preclinical

Molecular Formula: C26H26N2O5S

Molecular Weight: 478.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-n2c(SCc3cc(OC)c(OC)c(OC)c3)nc3ccc(C)cc3c2=O)cc1

Standard InChI:  InChI=1S/C26H26N2O5S/c1-16-6-11-21-20(12-16)25(29)28(18-7-9-19(30-2)10-8-18)26(27-21)34-15-17-13-22(31-3)24(33-5)23(14-17)32-4/h6-14H,15H2,1-5H3

Standard InChI Key:  GRMTVFCOBIDABP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   86.3065  -18.1979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   86.3053  -19.0253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.0201  -19.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.0183  -17.7852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.7337  -18.1943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   87.7345  -19.0211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   88.4498  -19.4321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   89.1648  -19.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.1600  -18.1874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   88.4441  -17.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.8690  -17.7723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.5862  -18.1821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   91.2977  -17.7660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   91.2931  -16.9401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.5711  -16.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.8626  -16.9507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   89.8809  -19.4271    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   89.8841  -20.2521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.6001  -20.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   90.6000  -21.4866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   91.3152  -21.8962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   92.0291  -21.4809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   92.0232  -20.6516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   91.3074  -20.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   88.4398  -16.9552    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   92.7457  -21.8896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   93.4580  -21.4734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   92.7346  -20.2338    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   91.3180  -22.7212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   92.0339  -23.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   92.7285  -19.4089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   85.5919  -17.7856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   92.0045  -16.5223    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   92.7220  -16.9295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
 23 28  1  0
 21 29  1  0
 29 30  1  0
 28 31  1  0
  1 32  1  0
 14 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3929211

    ---

Associated Targets(Human)

Leukemia cell (223 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Melanoma cell (242 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.57Molecular Weight (Monoisotopic): 478.1562AlogP: 5.02#Rotatable Bonds: 8
Polar Surface Area: 71.81Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.22CX LogP: 5.53CX LogD: 5.53
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -1.20

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source