The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9187397, 9a ID: ALA3929895
PubChem CID: 15941760
Max Phase: Preclinical
Molecular Formula: C28H26O6
Molecular Weight: 458.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=C/C(=O)/C(Cc2ccccc2)=C(O)/C=C/c2ccc(O)c(OC)c2)ccc1O
Standard InChI: InChI=1S/C28H26O6/c1-33-27-17-20(10-14-25(27)31)8-12-23(29)22(16-19-6-4-3-5-7-19)24(30)13-9-21-11-15-26(32)28(18-21)34-2/h3-15,17-18,29,31-32H,16H2,1-2H3/b12-8+,13-9+,23-22-
Standard InChI Key: RJYZAPXSNAXKPO-BTABOOAISA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6078 5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9078 5.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2078 5.9987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5082 5.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8060 6.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8034 7.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5031 8.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2053 7.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6109 7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5728 8.1014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9118 8.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9149 9.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2157 10.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2210 11.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5226 12.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8190 11.9885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8603 12.5849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8138 10.4885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1094 9.7310 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1036 8.5310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5122 9.7430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2688 5.8520 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 17 1 0
17 18 2 0
17 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
24 26 1 0
26 27 1 0
27 28 1 0
26 29 2 0
29 21 1 0
8 30 1 0
5 31 2 0
31 32 1 0
32 33 2 0
33 3 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.51Molecular Weight (Monoisotopic): 458.1729AlogP: 5.47#Rotatable Bonds: 9Polar Surface Area: 96.22Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.84CX Basic pKa: ┄CX LogP: 5.73CX LogD: 5.72Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: 0.21
References 1. (2015) Therapeutic curcumin derivatives,