US9187397, 9a

ID: ALA3929895

PubChem CID: 15941760

Max Phase: Preclinical

Molecular Formula: C28H26O6

Molecular Weight: 458.51

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(/C=C/C(=O)/C(Cc2ccccc2)=C(O)/C=C/c2ccc(O)c(OC)c2)ccc1O

Standard InChI:  InChI=1S/C28H26O6/c1-33-27-17-20(10-14-25(27)31)8-12-23(29)22(16-19-6-4-3-5-7-19)24(30)13-9-21-11-15-26(32)28(18-21)34-2/h3-15,17-18,29,31-32H,16H2,1-2H3/b12-8+,13-9+,23-22-

Standard InChI Key:  RJYZAPXSNAXKPO-BTABOOAISA-N

Molfile:  

     RDKit          2D

 34 36  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3070    5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6078    5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9078    5.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2078    5.9987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5082    5.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8060    6.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8034    7.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5031    8.2510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2053    7.4988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6109    7.4996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5728    8.1014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9118    8.2481    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9149    9.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2157   10.4975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2210   11.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5226   12.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8190   11.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8603   12.5849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8138   10.4885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1094    9.7310    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.1036    8.5310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5122    9.7430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2688    5.8520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 26 29  2  0
 29 21  1  0
  8 30  1  0
  5 31  2  0
 31 32  1  0
 32 33  2  0
 33  3  1  0
 33 34  1  0
M  END

Associated Targets(Human)

NFKB1 Tclin Nuclear factor NF-kappa-B p105 subunit (1459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
JUN Tchem Proto-oncogene c-JUN (434 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.51Molecular Weight (Monoisotopic): 458.1729AlogP: 5.47#Rotatable Bonds: 9
Polar Surface Area: 96.22Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.84CX Basic pKa: CX LogP: 5.73CX LogD: 5.72
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.22Np Likeness Score: 0.21

References

1.  (2015)  Therapeutic curcumin derivatives, 

Source

Source(1):