The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[(4-Methoxy-phenyl)-(4-trifluoromethyl-phenyl)-methyl]-piperazin-1-yl}-3,3-diphenyl-propan-1-one ID: ALA3930176
PubChem CID: 9915781
Max Phase: Preclinical
Molecular Formula: C34H33F3N2O2
Molecular Weight: 558.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(C(c2ccc(C(F)(F)F)cc2)N2CCN(C(=O)CC(c3ccccc3)c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C34H33F3N2O2/c1-41-30-18-14-28(15-19-30)33(27-12-16-29(17-13-27)34(35,36)37)39-22-20-38(21-23-39)32(40)24-31(25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-19,31,33H,20-24H2,1H3
Standard InChI Key: HDBMKSCBAFSILW-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
11.1104 -6.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2932 -6.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8846 -6.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -6.0388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0674 -6.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6588 -6.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8416 -6.7479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4330 -6.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8416 -5.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6588 -5.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2932 -5.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8846 -4.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2932 -3.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1104 -3.9157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -4.6248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1104 -5.3298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -7.4529 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.3362 -7.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7448 -8.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3362 -8.8711 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -8.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1104 -8.1620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7448 -9.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3362 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7448 -10.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3362 -11.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -11.6992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1104 -10.9942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5190 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1104 -12.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5620 -9.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9706 -8.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7877 -8.8711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1963 -9.5760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7877 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9706 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0135 -9.5760 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4221 -10.2851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2932 -12.4090 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.5196 -13.1156 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.6936 -13.1122 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
3 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
3 11 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
27 30 1 0
23 24 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
31 36 2 0
37 38 1 0
34 37 1 0
23 31 1 0
20 23 1 0
1 17 1 0
30 39 1 0
30 40 1 0
30 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 558.64Molecular Weight (Monoisotopic): 558.2494AlogP: 7.17#Rotatable Bonds: 8Polar Surface Area: 32.78Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.61CX LogP: 7.19CX LogD: 7.13Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -0.94
References 1. (2004) Calcium channel inhibitors comprising benzhydril spaced from piperazine,