US9206167, 21

ID: ALA3930364

PubChem CID: 66884891

Max Phase: Preclinical

Molecular Formula: C25H29N3OS

Molecular Weight: 419.59

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1CCc2ccccc2N1CCCCN1CCN(c2cccc3sccc23)CC1

Standard InChI:  InChI=1S/C25H29N3OS/c29-25-11-10-20-6-1-2-7-22(20)28(25)14-4-3-13-26-15-17-27(18-16-26)23-8-5-9-24-21(23)12-19-30-24/h1-2,5-9,12,19H,3-4,10-11,13-18H2

Standard InChI Key:  YFZQHYRTAYCBIY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 30 34  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8971   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3070   -5.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6078   -5.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6109   -7.4996    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9100   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9100   -9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6110  -10.4997    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3119   -9.7497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3119   -8.2497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6110  -12.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3108  -12.7485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3085  -14.2485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6063  -15.0005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9065  -14.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3316  -14.7183    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2151  -13.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3353  -12.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9089  -12.7526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
 11  2  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 16  1  0
 19 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 22  1  0
 30 26  2  0
M  END

Associated Targets(non-human)

Htr2a Serotonin 2a (5-HT2a) receptor (3540 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.59Molecular Weight (Monoisotopic): 419.2031AlogP: 4.78#Rotatable Bonds: 6
Polar Surface Area: 26.79Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.19CX LogP: 4.59CX LogD: 3.73
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.54Np Likeness Score: -1.58

References

1.  (2015)  Piperazine-substituted benzothiophenes for treatment of mental disorders, 

Source

Source(1):