(S)-N-((S)-1-((S)-2-carbamoylpyrrolidin-1-yl)-3-methyl-1-oxobutan-2-yl)-5-oxopyrrolidine-2-carboxamide

ID: ALA3931015

Cas Number: 78058-07-8

PubChem CID: 5311405

Max Phase: Preclinical

Molecular Formula: C15H24N4O4

Molecular Weight: 324.38

Molecule Type: Protein

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)N1CCC[C@H]1C(N)=O

Standard InChI:  InChI=1S/C15H24N4O4/c1-8(2)12(18-14(22)9-5-6-11(20)17-9)15(23)19-7-3-4-10(19)13(16)21/h8-10,12H,3-7H2,1-2H3,(H2,16,21)(H,17,20)(H,18,22)/t9-,10-,12-/m0/s1

Standard InChI Key:  UUHCMPUVYJWCBO-NHCYSSNCSA-N

Molfile:  

     RDKit          2D

 23 24  0  0  0  0  0  0  0  0999 V2000
    6.7459  -15.0001    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4604  -14.5876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1748  -15.0001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8893  -14.5876    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.1748  -15.8251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7459  -15.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0314  -16.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4604  -16.2376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2781  -15.9073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7261  -16.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1386  -17.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9455  -17.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9056  -16.4341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6430  -14.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8168  -15.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2053  -16.2784    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6021  -15.9774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4604  -13.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1748  -13.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7459  -13.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9710  -13.7667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7770  -13.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1934  -14.3028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  3  5  2  0
  1  6  1  0
  7  6  1  6
  6  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  7  1  0
 10 13  2  0
 14 15  1  1
 15 16  1  0
 15 17  2  0
  2 18  1  1
 18 19  1  0
 18 20  1  0
  4 21  1  0
 14  4  1  0
 14 23  1  0
 21 22  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3931015

    [Val2]TRH

Associated Targets(non-human)

TRHDE Thyrotropin releasing hormone degrading enzyme (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 324.38Molecular Weight (Monoisotopic): 324.1798AlogP: -1.12#Rotatable Bonds: 5
Polar Surface Area: 121.60Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.43CX Basic pKa: CX LogP: -1.61CX LogD: -1.61
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.59Np Likeness Score: -0.44

References

1.  (2010)  TRH-like peptide derivatives as inhibitors of the TRH-degrading ectoenzyme, 

Source