The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9283225, A3 ID: ALA3931180
PubChem CID: 71261869
Max Phase: Preclinical
Molecular Formula: C24H19FN6O3
Molecular Weight: 458.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(C(=O)Nc2ccc(Oc3ccnc4c3CNC(=O)N4)c(F)c2)cnn1-c1ccccc1
Standard InChI: InChI=1S/C24H19FN6O3/c1-14-17(13-28-31(14)16-5-3-2-4-6-16)23(32)29-15-7-8-21(19(25)11-15)34-20-9-10-26-22-18(20)12-27-24(33)30-22/h2-11,13H,12H2,1H3,(H,29,32)(H2,26,27,30,33)
Standard InChI Key: IEUZMGFDZGWUSU-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
11.9907 -0.2705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7442 0.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3907 1.5203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5234 3.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9895 3.3185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7440 2.0221 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.2371 1.8704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1997 3.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6764 2.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1865 1.3401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2200 0.1930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7433 0.4565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0920 0.7680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0940 -0.4320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7907 1.5158 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6373 -3.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -3.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2049 -2.6909 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 2 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
3 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
30 31 1 0
31 21 1 0
31 25 2 0
19 32 1 0
32 33 1 0
32 34 2 0
34 16 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.45Molecular Weight (Monoisotopic): 458.1503AlogP: 4.39#Rotatable Bonds: 5Polar Surface Area: 110.17Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.57CX Basic pKa: 4.46CX LogP: 3.25CX LogD: 3.25Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.67
References 1. (2016) Pyrido-pyrimidine derivatives,