US9283225, A3

ID: ALA3931180

PubChem CID: 71261869

Max Phase: Preclinical

Molecular Formula: C24H19FN6O3

Molecular Weight: 458.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(C(=O)Nc2ccc(Oc3ccnc4c3CNC(=O)N4)c(F)c2)cnn1-c1ccccc1

Standard InChI:  InChI=1S/C24H19FN6O3/c1-14-17(13-28-31(14)16-5-3-2-4-6-16)23(32)29-15-7-8-21(19(25)11-15)34-20-9-10-26-22-18(20)12-27-24(33)30-22/h2-11,13H,12H2,1H3,(H,29,32)(H2,26,27,30,33)

Standard InChI Key:  IEUZMGFDZGWUSU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   11.9907   -0.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7442    0.9039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3907    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5234    3.0016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9895    3.3185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.7440    2.0221    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2371    1.8704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1997    3.0142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6764    2.7507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1865    1.3401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2200    0.1930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7433    0.4565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0920    0.7680    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0940   -0.4320    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7907    1.5158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6373   -3.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2049   -2.6909    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  2  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  3 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 21  1  0
 31 25  2  0
 19 32  1  0
 32 33  1  0
 32 34  2  0
 34 16  1  0
M  END

Associated Targets(Human)

MST1R Tchem Macrophage-stimulating protein receptor (2327 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.45Molecular Weight (Monoisotopic): 458.1503AlogP: 4.39#Rotatable Bonds: 5
Polar Surface Area: 110.17Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.57CX Basic pKa: 4.46CX LogP: 3.25CX LogD: 3.25
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -1.67

References

1.  (2016)  Pyrido-pyrimidine derivatives, 

Source

Source(1):