The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447087, 100 ID: ALA3931907
PubChem CID: 46926079
Max Phase: Preclinical
Molecular Formula: C25H20ClN9O2S
Molecular Weight: 546.02
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2nnc(-c3ccccc3)s2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C25H20ClN9O2S/c1-13-18(21(36)30-25-33-32-22(38-25)14-8-4-3-5-9-14)20(19-15(26)12-35(2)34-19)29-23(27-13)31-24-28-16-10-6-7-11-17(16)37-24/h3-12,20H,1-2H3,(H,30,33,36)(H2,27,28,29,31)
Standard InChI Key: HKZXAIUTSKUSIE-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-1.6572 -7.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5341 -9.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0147 -9.7621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3238 -11.2299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4192 -11.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0234 -11.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9106 -10.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7349 -11.2120 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -9.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6640 -9.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2838 -10.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4685 -12.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1479 -13.5662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9703 -14.5660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2668 -13.8115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9498 -12.3453 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6399 -14.4171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9118 -15.8872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3259 -16.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4663 -15.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1925 -13.9383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7785 -13.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 8 2 0
6 17 1 0
17 2 1 0
4 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 28 1 0
31 33 1 0
33 34 2 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.02Molecular Weight (Monoisotopic): 545.1149AlogP: 4.76#Rotatable Bonds: 5Polar Surface Area: 135.15Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 6.90CX Basic pKa: 2.94CX LogP: 4.08CX LogD: 3.53Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.29Np Likeness Score: -1.70
References 1. (2016) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,