The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-1-((S)-2-carbamoylpyrrolidin-1-yl)-1-oxo-4-phenylbutan-2-yl)-5-oxopyrrolidine-2-carboxamide ID: ALA3933726
PubChem CID: 10340115
Max Phase: Preclinical
Molecular Formula: C20H26N4O4
Molecular Weight: 386.45
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@@H]1CCCN1C(=O)[C@H](CCc1ccccc1)NC(=O)[C@@H]1CCC(=O)N1
Standard InChI: InChI=1S/C20H26N4O4/c21-18(26)16-7-4-12-24(16)20(28)15(9-8-13-5-2-1-3-6-13)23-19(27)14-10-11-17(25)22-14/h1-3,5-6,14-16H,4,7-12H2,(H2,21,26)(H,22,25)(H,23,27)/t14-,15-,16-/m0/s1
Standard InChI Key: ZKGYSCIDBBYKKJ-JYJNAYRXSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
7.7834 -16.8293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4979 -16.4168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2124 -16.8293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9268 -16.4168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2124 -17.6543 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7834 -17.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0690 -18.0668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4979 -18.0668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3156 -17.7364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7636 -18.3495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1761 -19.0641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9830 -18.8924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9431 -18.2633 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4979 -15.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6806 -16.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2326 -16.1342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8201 -15.4197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0131 -15.5914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8543 -17.5539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2427 -18.1076 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6396 -17.8066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7834 -15.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7834 -14.3543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5002 -13.9437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5005 -13.1194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7855 -12.7060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0686 -13.1230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0719 -13.9459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
3 4 1 0
3 5 2 0
1 6 1 0
7 6 1 6
6 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
10 13 2 0
2 14 1 0
4 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 4 1 0
15 19 1 1
19 20 1 0
19 21 2 0
14 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 386.45Molecular Weight (Monoisotopic): 386.1954AlogP: -0.14#Rotatable Bonds: 7Polar Surface Area: 121.60Molecular Species: NEUTRALHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.43CX Basic pKa: ┄CX LogP: -0.40CX LogD: -0.40Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.60Np Likeness Score: -0.33
References 1. (2010) TRH-like peptide derivatives as inhibitors of the TRH-degrading ectoenzyme,