US9173869, 39

ID: ALA3933970

PubChem CID: 68393057

Max Phase: Preclinical

Molecular Formula: C31H34FN3O2

Molecular Weight: 499.63

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCC(c1nc2ccccc2c(=O)n1-c1ccc(C)cc1)N(CCc1ccccc1)C(=O)CCCCF

Standard InChI:  InChI=1S/C31H34FN3O2/c1-3-28(34(29(36)15-9-10-21-32)22-20-24-11-5-4-6-12-24)30-33-27-14-8-7-13-26(27)31(37)35(30)25-18-16-23(2)17-19-25/h4-8,11-14,16-19,28H,3,9-10,15,20-22H2,1-2H3

Standard InChI Key:  ZKPGOMKDCOZJTD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    3.6471   -3.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6060   -2.9986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0994   -0.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3984   -1.4891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3984   -2.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0993   -3.7391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -2.9890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8995    0.7553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8603    1.3553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1990    1.5061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1995    3.0069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4991    3.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4996    5.2586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5386    5.8589    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0067   -7.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  7  1  0
  4 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
  3 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 20  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 34 36  1  0
 36 37  2  0
 37 31  1  0
M  END

Associated Targets(non-human)

Shh Sonic hedgehog protein (356 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 499.63Molecular Weight (Monoisotopic): 499.2635AlogP: 6.36#Rotatable Bonds: 11
Polar Surface Area: 55.20Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.43CX LogP: 6.44CX LogD: 6.44
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -1.04

References

1.  (2015)  Mediators of hedgehog signaling pathways, compositions and uses related thereto, 

Source

Source(1):