The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9173869, 39 ID: ALA3933970
PubChem CID: 68393057
Max Phase: Preclinical
Molecular Formula: C31H34FN3O2
Molecular Weight: 499.63
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCC(c1nc2ccccc2c(=O)n1-c1ccc(C)cc1)N(CCc1ccccc1)C(=O)CCCCF
Standard InChI: InChI=1S/C31H34FN3O2/c1-3-28(34(29(36)15-9-10-21-32)22-20-24-11-5-4-6-12-24)30-33-27-14-8-7-13-26(27)31(37)35(30)25-18-16-23(2)17-19-25/h4-8,11-14,16-19,28H,3,9-10,15,20-22H2,1-2H3
Standard InChI Key: ZKPGOMKDCOZJTD-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
3.6471 -3.5953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6060 -2.9986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0994 -0.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3984 -1.4891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3984 -2.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0993 -3.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -2.9890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8995 0.7553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8603 1.3553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1990 1.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1995 3.0069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4991 3.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4996 5.2586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5386 5.8589 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -7.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
4 13 1 0
13 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
3 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 20 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
34 36 1 0
36 37 2 0
37 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 499.63Molecular Weight (Monoisotopic): 499.2635AlogP: 6.36#Rotatable Bonds: 11Polar Surface Area: 55.20Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.43CX LogP: 6.44CX LogD: 6.44Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.23Np Likeness Score: -1.04
References 1. (2015) Mediators of hedgehog signaling pathways, compositions and uses related thereto,