US9394303, 7

ID: ALA3934675

PubChem CID: 118414932

Max Phase: Preclinical

Molecular Formula: C25H19N3O3

Molecular Weight: 409.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(Cc2ccc(-c3ccccc3)cc2)c2nc(-c3ccco3)cc(C(=O)O)c12

Standard InChI:  InChI=1S/C25H19N3O3/c1-16-23-20(25(29)30)14-21(22-8-5-13-31-22)26-24(23)28(27-16)15-17-9-11-19(12-10-17)18-6-3-2-4-7-18/h2-14H,15H2,1H3,(H,29,30)

Standard InChI Key:  VCOKWPGYJIDRHC-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
   -0.4916   -3.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8794   -1.4442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8823   -2.5608    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3506   -2.2538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3506   -3.3718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8824   -4.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4142   -5.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4142   -3.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8830   -5.9154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3518   -5.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3500   -6.7304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8796   -8.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4109   -8.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4126   -7.3398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6003   -1.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6387   -0.8963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6024   -2.6978    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2121    3.8625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7463    5.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7537    5.2860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2149    3.8587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11  6  1  0
  9 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 12  1  0
  4 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 23 25  1  0
 22 26  2  0
 26  2  1  0
 26 18  1  0
 20 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 27  2  0
M  END

Associated Targets(non-human)

Mcl1 Induced myeloid leukemia cell differentiation protein Mcl-1 homolog (108 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.45Molecular Weight (Monoisotopic): 409.1426AlogP: 5.41#Rotatable Bonds: 5
Polar Surface Area: 81.15Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.51CX Basic pKa: 1.78CX LogP: 4.68CX LogD: 1.45
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.42Np Likeness Score: -1.49

References

1.  (2016)  Small molecule inhibitors of MCL-1 and uses thereof, 

Source

Source(1):