2-Fluoro-N-[5-(thiazol-2-yl sulfamoyl)-quinolin-8-yl]-benzamide

ID: ALA3934729

PubChem CID: 16051134

Max Phase: Preclinical

Molecular Formula: C19H13FN4O3S2

Molecular Weight: 428.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)c2cccnc12)c1ccccc1F

Standard InChI:  InChI=1S/C19H13FN4O3S2/c20-14-6-2-1-4-12(14)18(25)23-15-7-8-16(13-5-3-9-21-17(13)15)29(26,27)24-19-22-10-11-28-19/h1-11H,(H,22,24)(H,23,25)

Standard InChI Key:  HWDRQVTWEDWSQL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    0.9066   -2.3262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6105   -1.9190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3147   -2.3257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3147   -3.1410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6131   -3.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9066   -3.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6131   -4.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3208   -4.7741    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3208   -5.5891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0233   -5.9969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0233   -6.8125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3194   -7.2202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6087   -6.8134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6087   -5.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3194   -8.0352    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.0230   -8.4427    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0230   -9.2576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7470   -9.6751    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5603  -10.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7514  -10.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4136   -9.8201    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.5022   -8.0352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9107   -8.7381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7319   -7.2214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4330   -6.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4330   -6.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7269   -5.5946    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9053   -4.7741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0225   -3.5526    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  2  0
 11 10  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
  9 14  1  0
 12 15  1  0
 15 16  1  0
 16 17  1  0
 18 17  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 17 21  2  0
 15 22  2  0
 15 23  2  0
 11 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 10 27  1  0
  7 28  2  0
  4 29  1  0
M  END

Associated Targets(non-human)

Scn11a Voltage-gated sodium channel (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 428.47Molecular Weight (Monoisotopic): 428.0413AlogP: 3.88#Rotatable Bonds: 5
Polar Surface Area: 101.05Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.68CX Basic pKa: 1.02CX LogP: 3.20CX LogD: 2.60
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.50Np Likeness Score: -2.35

References

1.  (2012)  Bicyclic derivatives as modulators of voltage gated ion channels, 

Source