The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9173869, 52 ID: ALA3935394
PubChem CID: 11497223
Max Phase: Preclinical
Molecular Formula: C25H20F4N4O2S
Molecular Weight: 516.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(c1nc2ccccc2c(=O)n1-c1ccc(F)cc1)N(C)C(=O)Nc1cccc(SC(F)(F)F)c1
Standard InChI: InChI=1S/C25H20F4N4O2S/c1-15(32(2)24(35)30-17-6-5-7-19(14-17)36-25(27,28)29)22-31-21-9-4-3-8-20(21)23(34)33(22)18-12-10-16(26)11-13-18/h3-15H,1-2H3,(H,30,35)
Standard InChI Key: RSIKSCDXJPWLLJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
2.6024 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 0.4545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0994 -0.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3984 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3985 -2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0995 -3.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0964 -5.2395 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7956 -5.9881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7932 -7.1881 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.7574 -5.3864 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.7553 -6.5862 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.8004 -2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -7.2009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
12 18 2 0
18 8 1 0
2 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
26 27 1 0
27 28 2 0
27 29 1 0
29 19 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
33 35 1 0
35 36 2 0
36 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 516.52Molecular Weight (Monoisotopic): 516.1243AlogP: 6.36#Rotatable Bonds: 5Polar Surface Area: 67.23Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.08CX Basic pKa: 0.44CX LogP: 6.36CX LogD: 6.36Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.25Np Likeness Score: -1.71
References 1. (2015) Mediators of hedgehog signaling pathways, compositions and uses related thereto,