US9173884, BC11-19-5

ID: ALA3935458

Cas Number: 522652-41-1

PubChem CID: 1213295

Max Phase: Preclinical

Molecular Formula: C16H10ClN3O3S

Molecular Weight: 359.79

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c(c1)sc1nc(=O)n(-c3cccc(Cl)c3)c(=O)n12

Standard InChI:  InChI=1S/C16H10ClN3O3S/c1-23-11-5-6-12-13(8-11)24-15-18-14(21)19(16(22)20(12)15)10-4-2-3-9(17)7-10/h2-8H,1H3

Standard InChI Key:  WZXVKFIBUSGTCO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
    2.5956   -2.7031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0972    0.1560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7073    1.5263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9008    1.6518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8257    2.7399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3339    2.5831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6283    3.5538    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4361    4.1109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9277    4.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5356    5.6414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6520    6.8535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1605    6.6944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4536    7.6641    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -4.5525    5.3231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13  7  1  0
 13 14  2  0
 12 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  1  0
 19 21  2  0
 21 15  1  0
  8 22  1  0
 22 23  1  0
 23  6  1  0
 23 24  2  0
 24  3  1  0
M  END

Associated Targets(Human)

PDE11A Tchem Phosphodiesterase 11A (449 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 359.79Molecular Weight (Monoisotopic): 359.0131AlogP: 2.72#Rotatable Bonds: 2
Polar Surface Area: 65.60Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.85CX LogD: 3.85
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.55Np Likeness Score: -1.88

References

1.  (2015)  Inhibitors of phosphodiesterase 11 (PDE11), 

Source

Source(1):