(S)-4-fluoro-N-(4-(1-(8-methyl-2-(methylamino)quinazolin-4-ylamino)ethyl)phenyl)benzamide

ID: ALA3935474

PubChem CID: 68938888

Max Phase: Preclinical

Molecular Formula: C25H24FN5O

Molecular Weight: 429.50

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  CNc1nc(N[C@@H](C)c2ccc(NC(=O)c3ccc(F)cc3)cc2)c2cccc(C)c2n1

Standard InChI:  InChI=1S/C25H24FN5O/c1-15-5-4-6-21-22(15)30-25(27-3)31-23(21)28-16(2)17-9-13-20(14-10-17)29-24(32)18-7-11-19(26)12-8-18/h4-14,16H,1-3H3,(H,29,32)(H2,27,28,30,31)/t16-/m0/s1

Standard InChI Key:  LBWYBHYHBIMHKK-INIZCTEOSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   23.2868  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5736  -13.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.5736  -14.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8645  -14.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1513  -14.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.1513  -13.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8645  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.2868  -12.2414    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0001  -13.4713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7133  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7133  -12.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4182  -11.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1315  -12.2414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1315  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.4182  -13.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8405  -11.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8405  -11.0073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.5538  -12.2414    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5538  -14.7053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.8405  -14.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.8405  -13.4713    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   27.5538  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2670  -13.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9761  -13.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6893  -13.4713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6893  -14.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9761  -14.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2670  -14.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.1315  -14.7053    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.1315  -15.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.9761  -15.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4381  -14.7053    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  6
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 19 28  2  0
 23 28  1  0
 29 30  1  0
 20 29  1  0
 27 31  1  0
 18 22  1  0
 16 18  1  0
 13 16  1  0
  9 10  1  0
  5 32  1  0
M  END

Associated Targets(Human)

CTNNB1 Tchem TCF4/beta-catenin (616 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.50Molecular Weight (Monoisotopic): 429.1965AlogP: 5.54#Rotatable Bonds: 6
Polar Surface Area: 78.94Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.68CX LogP: 5.53CX LogD: 5.46
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -1.62

References

1.  (2009)  Amino-substituted quinazoline derivatives as inhibitors of Beta-catenin/TCF-4 pathway and cancer treatment agents, 

Source