The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(N-(2-((2-(indolin-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-ylamino)methyl)phenyl)ethylsulfonamido)pentanoic acid ID: ALA3936048
PubChem CID: 134149369
Max Phase: Preclinical
Molecular Formula: C27H31F3N6O4S
Molecular Weight: 592.64
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCS(=O)(=O)N(CCCCC(=O)O)c1ccccc1CNc1nc(Nc2ccc3c(c2)CCN3)ncc1C(F)(F)F
Standard InChI: InChI=1S/C27H31F3N6O4S/c1-2-41(39,40)36(14-6-5-9-24(37)38)23-8-4-3-7-19(23)16-32-25-21(27(28,29)30)17-33-26(35-25)34-20-10-11-22-18(15-20)12-13-31-22/h3-4,7-8,10-11,15,17,31H,2,5-6,9,12-14,16H2,1H3,(H,37,38)(H2,32,33,34,35)
Standard InChI Key: RVULLEYKHMQYRU-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 44 0 0 0 0 0 0 0 0999 V2000
7.0493 -14.1358 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2321 -14.1358 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.6407 -14.8435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8988 -9.6742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8977 -10.4937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6057 -10.9027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3154 -10.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3125 -9.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6039 -9.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0160 -9.2594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6585 -8.8852 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.8154 -9.5599 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.1491 -8.4158 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0237 -10.9007 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0250 -11.7179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7334 -12.1254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7300 -12.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4376 -13.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1456 -12.9376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1417 -12.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4336 -11.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1891 -10.9026 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9819 -11.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1940 -11.9074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3596 -13.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5632 -12.2639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5680 -13.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9840 -12.6989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2578 -13.0771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3931 -13.8846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2028 -14.0053 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0216 -13.3475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2044 -13.3433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7923 -14.0490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9751 -14.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5629 -14.7505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6538 -14.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8646 -15.5026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9679 -15.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5558 -16.1659 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7851 -15.4644 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 12 1 0
10 13 1 0
8 10 1 0
7 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
17 32 1 0
5 22 1 0
22 23 1 0
23 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 23 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
32 33 1 0
32 2 1 0
33 34 1 0
34 35 1 0
35 36 1 0
2 37 1 0
37 38 1 0
36 39 1 0
39 40 2 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.64Molecular Weight (Monoisotopic): 592.2080AlogP: 5.23#Rotatable Bonds: 13Polar Surface Area: 136.55Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.06CX Basic pKa: 5.98CX LogP: 2.04CX LogD: 1.05Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.20Np Likeness Score: -1.12
References 1. Farand J, Mai N, Chandrasekhar J, Newby ZE, Van Veldhuizen J, Loyer-Drew J, Venkataramani C, Guerrero J, Kwok A, Li N, Zherebina Y, Wilbert S, Zablocki J, Phillips G, Watkins WJ, Mourey R, Notte GT.. (2016) Selectivity switch between FAK and Pyk2: Macrocyclization of FAK inhibitors improves Pyk2 potency., 26 (24): [PMID:27876318 ] [10.1016/j.bmcl.2016.10.092 ]