The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(4-((2-(3-Fluorophenyl)-4,5-diphenyl-1H-imidazol-1-yl)methyl)-1H-1,2,3-triazol-1-yl)-N-(o-tolyl)acetamide ID: ALA3936073
PubChem CID: 134148325
Max Phase: Preclinical
Molecular Formula: C33H27FN6O
Molecular Weight: 542.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccccc1NC(=O)Cn1cc(Cn2c(-c3cccc(F)c3)nc(-c3ccccc3)c2-c2ccccc2)nn1
Standard InChI: InChI=1S/C33H27FN6O/c1-23-11-8-9-18-29(23)35-30(41)22-39-20-28(37-38-39)21-40-32(25-14-6-3-7-15-25)31(24-12-4-2-5-13-24)36-33(40)26-16-10-17-27(34)19-26/h2-20H,21-22H2,1H3,(H,35,41)
Standard InChI Key: UHMFKCDVSHMDSW-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
7.6128 -8.7330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4252 -8.6620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1418 -8.0655 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2672 -9.4755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4506 -9.5465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1063 -10.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2914 -10.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8212 -9.6844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1685 -8.9474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9853 -8.8778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7708 -7.9236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3525 -7.1940 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9073 -6.6024 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6462 -6.9428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5482 -7.7536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3616 -6.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0475 -5.2617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8066 -4.4813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9760 -4.4769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7244 -5.2406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3789 -5.7317 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9430 -5.4862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3435 -4.9348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5626 -5.1677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3807 -5.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9819 -6.5201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7610 -6.2803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5051 -3.8094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8358 -3.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3678 -2.4079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5506 -2.4778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2057 -3.2201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6743 -3.8925 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8180 -5.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9752 -6.3309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7485 -6.5958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3640 -6.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2086 -5.2563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4377 -4.9910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9058 -7.3977 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.5746 -10.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 3 2 0
1 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
4 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
11 15 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
17 21 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
22 27 2 0
20 22 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
28 33 2 0
19 28 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
34 39 2 0
17 34 1 0
16 21 1 0
14 16 1 0
2 11 1 0
36 40 1 0
6 41 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 542.62Molecular Weight (Monoisotopic): 542.2230AlogP: 6.61#Rotatable Bonds: 8Polar Surface Area: 77.63Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.40CX Basic pKa: 4.39CX LogP: 7.12CX LogD: 7.12Aromatic Rings: 6Heavy Atoms: 41QED Weighted: 0.23Np Likeness Score: -1.81
References 1. Wang G, Peng Z, Wang J, Li J, Li X.. (2016) Synthesis and biological evaluation of novel 2,4,5-triarylimidazole-1,2,3-triazole derivatives via click chemistry as α-glucosidase inhibitors., 26 (23): [PMID:27810241 ] [10.1016/j.bmcl.2016.10.057 ] 2. Dhameja M, Gupta P.. (2019) Synthetic heterocyclic candidates as promising α-glucosidase inhibitors: An overview., 176 [PMID:31112894 ] [10.1016/j.ejmech.2019.04.025 ]