3-(2-methoxyphenyl)-6-methyl-2-(3,4,5-trimethoxybenzylthio)quinazolin-4(3H)-one

ID: ALA3936767

PubChem CID: 134148594

Max Phase: Preclinical

Molecular Formula: C26H26N2O5S

Molecular Weight: 478.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccccc1-n1c(SCc2cc(OC)c(OC)c(OC)c2)nc2ccc(C)cc2c1=O

Standard InChI:  InChI=1S/C26H26N2O5S/c1-16-10-11-19-18(12-16)25(29)28(20-8-6-7-9-21(20)30-2)26(27-19)34-15-17-13-22(31-3)24(33-5)23(14-17)32-4/h6-14H,15H2,1-5H3

Standard InChI Key:  BGIWNLHHOHJCJO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   60.1064  -26.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.1053  -27.0711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.8201  -27.4840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.8183  -25.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   61.5337  -26.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   61.5345  -27.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   62.2498  -27.4779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   62.9648  -27.0632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   62.9600  -26.2332    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   62.2441  -25.8260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   63.6689  -25.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   64.3862  -26.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.0977  -25.8118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.0931  -24.9859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   64.3711  -24.5780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   63.6626  -24.9965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   63.6809  -27.4729    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   63.6841  -28.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   64.4001  -28.7076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   64.4000  -29.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.1152  -29.9420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.8291  -29.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.8232  -28.6975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.1074  -28.2915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   62.2398  -25.0010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   66.5457  -29.9355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   67.2580  -29.5192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   66.5346  -28.2797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   65.1180  -30.7670    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   65.8339  -31.1771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   66.5284  -27.4547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   59.3919  -25.8314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   62.9445  -24.5903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   62.9372  -23.7654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
 23 28  1  0
 21 29  1  0
 29 30  1  0
 28 31  1  0
  1 32  1  0
 16 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3936767

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 478.57Molecular Weight (Monoisotopic): 478.1562AlogP: 5.02#Rotatable Bonds: 8
Polar Surface Area: 71.81Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 0.01CX LogP: 5.53CX LogD: 5.53
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -1.19

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source