The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2,5-difluoro-N-(5-(N-thiazol-2-ylsulfamoyl)quinolin-8-yl)benzamide ID: ALA3937475
PubChem CID: 16051136
Max Phase: Preclinical
Molecular Formula: C19H12F2N4O3S2
Molecular Weight: 446.46
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)c2cccnc12)c1cc(F)ccc1F
Standard InChI: InChI=1S/C19H12F2N4O3S2/c20-11-3-4-14(21)13(10-11)18(26)24-15-5-6-16(12-2-1-7-22-17(12)15)30(27,28)25-19-23-8-9-29-19/h1-10H,(H,23,25)(H,24,26)
Standard InChI Key: VBZDSPWJTVIKAH-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
18.3060 -2.9137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0140 -2.5024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7182 -2.9132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7182 -3.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0125 -4.1350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3060 -3.7296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0125 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7202 -5.3575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.7202 -6.1725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4268 -6.5803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4268 -7.3959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7187 -7.8035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0122 -7.3968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0122 -6.5825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7187 -8.6185 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.4265 -9.0260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4265 -9.8410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1505 -10.2585 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
20.9597 -11.0923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.1508 -11.1726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8130 -10.4035 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.9016 -8.6185 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3101 -9.3256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.1354 -7.8047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8365 -7.3942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8365 -6.5845 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.1304 -6.1779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.3088 -5.3575 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.4218 -4.1360 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
17.5983 -2.5021 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 1 0
8 9 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
9 14 1 0
12 15 1 0
15 16 1 0
16 17 1 0
18 17 1 0
18 19 1 0
19 20 2 0
21 20 1 0
17 21 2 0
15 22 2 0
15 23 2 0
11 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
10 27 1 0
7 28 2 0
4 29 1 0
1 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.46Molecular Weight (Monoisotopic): 446.0319AlogP: 4.02#Rotatable Bonds: 5Polar Surface Area: 101.05Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 6.68CX Basic pKa: 1.02CX LogP: 3.34CX LogD: 2.75Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: -2.47
References 1. (2012) Bicyclic derivatives as modulators of voltage gated ion channels,