The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(2,4-dimethoxyphenyl)-6-methyl-2-(3,4,5-trimethoxybenzylthio)quinazolin-4(3H)-one ID: ALA3938255
PubChem CID: 134148830
Max Phase: Preclinical
Molecular Formula: C27H28N2O6S
Molecular Weight: 508.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2c(SCc3cc(OC)c(OC)c(OC)c3)nc3ccc(C)cc3c2=O)c(OC)c1
Standard InChI: InChI=1S/C27H28N2O6S/c1-16-7-9-20-19(11-16)26(30)29(21-10-8-18(31-2)14-22(21)32-3)27(28-20)36-15-17-12-23(33-4)25(35-6)24(13-17)34-5/h7-14H,15H2,1-6H3
Standard InChI Key: QURBHNYJXRPMES-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
68.4481 -26.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
68.4470 -27.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
69.1618 -27.5090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
69.1600 -25.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
69.8754 -26.2651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
69.8761 -27.0920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
70.5914 -27.5029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
71.3065 -27.0882 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
71.3017 -26.2582 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
70.5858 -25.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.0106 -25.8431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.7279 -26.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
73.4393 -25.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
73.4348 -25.0109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.7128 -24.6030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.0043 -25.0215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.0225 -27.4979 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
72.0257 -28.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.7418 -28.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
72.7416 -29.5574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
73.4569 -29.9670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
74.1707 -29.5517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
74.1648 -28.7225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
73.4490 -28.3165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
70.5814 -25.0260 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
74.8873 -29.9605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
75.5996 -29.5442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
74.8762 -28.3047 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
73.4597 -30.7920 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
74.1755 -31.2021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
74.8701 -27.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
67.7335 -25.8564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
71.2862 -24.6153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
74.1462 -24.5932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
71.2789 -23.7904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
74.8637 -25.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
8 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
10 25 2 0
22 26 1 0
26 27 1 0
23 28 1 0
21 29 1 0
29 30 1 0
28 31 1 0
1 32 1 0
16 33 1 0
14 34 1 0
33 35 1 0
34 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.60Molecular Weight (Monoisotopic): 508.1668AlogP: 5.03#Rotatable Bonds: 9Polar Surface Area: 81.04Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.37CX LogD: 5.37Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.23Np Likeness Score: -1.11
References 1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI.. (2016) Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates., 26 (19): [PMID:27554444 ] [10.1016/j.bmcl.2016.08.022 ]