(S)-6-chloro-N-(4-(1-(2-(dimethylamino)-6-methylquinazolin-4-ylamino)ethyl)phenyl)nicotinamide

ID: ALA3938256

PubChem CID: 87628953

Max Phase: Preclinical

Molecular Formula: C25H25ClN6O

Molecular Weight: 460.97

Molecule Type: Small molecule

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N(C)C)nc(N[C@@H](C)c3ccc(NC(=O)c4ccc(Cl)nc4)cc3)c2c1

Standard InChI:  InChI=1S/C25H25ClN6O/c1-15-5-11-21-20(13-15)23(31-25(30-21)32(3)4)28-16(2)17-6-9-19(10-7-17)29-24(33)18-8-12-22(26)27-14-18/h5-14,16H,1-4H3,(H,29,33)(H,28,30,31)/t16-/m0/s1

Standard InChI Key:  PQPJKBSPXRPUKP-INIZCTEOSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    7.0580  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3448  -14.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3448  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6357  -16.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9225  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9225  -14.8621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6357  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0580  -13.6322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7671  -14.8622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.4762  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4762  -13.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1894  -13.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8985  -13.6322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8985  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1894  -14.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6117  -13.2195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6117  -12.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3249  -13.6322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3249  -16.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.6117  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6117  -14.8622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3249  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0381  -14.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7472  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4563  -14.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4563  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7472  -16.0962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0381  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1654  -14.4536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8985  -16.0962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1894  -15.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8985  -16.9175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2093  -16.0962    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 16 17  1  6
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 19 28  2  0
 23 28  1  0
 25 29  1  0
 30 31  1  0
 30 32  1  0
 20 30  1  0
 18 22  1  0
 16 18  1  0
 13 16  1  0
  9 10  1  0
  5 33  1  0
M  END

Associated Targets(Human)

CTNNB1 Tchem TCF4/beta-catenin (616 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.97Molecular Weight (Monoisotopic): 460.1778AlogP: 5.48#Rotatable Bonds: 6
Polar Surface Area: 83.04Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.64CX LogP: 5.63CX LogD: 5.56
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: -1.72

References

1.  (2009)  Amino-substituted quinazoline derivatives as inhibitors of Beta-catenin/TCF-4 pathway and cancer treatment agents, 

Source