The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447085, 5 ID: ALA3938461
PubChem CID: 76284385
Max Phase: Preclinical
Molecular Formula: C19H23FN6O4S
Molecular Weight: 450.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO/N=C(/Nc1ccc(F)c([C@]2(C)CS(=O)(=O)N(C)C(=N)N2)c1)c1ccc(OC)cn1
Standard InChI: InChI=1S/C19H23FN6O4S/c1-19(11-31(27,28)26(2)18(21)24-19)14-9-12(5-7-15(14)20)23-17(25-30-4)16-8-6-13(29-3)10-22-16/h5-10H,11H2,1-4H3,(H2,21,24)(H,23,25)/t19-/m0/s1
Standard InChI Key: VQGLZCUJHDZRDR-IBGZPJMESA-N
Molfile:
RDKit 2D
31 33 0 0 1 0 0 0 0 0999 V2000
-1.0464 -3.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0048 -2.9949 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2925 -3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8902 -3.7623 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8819 -5.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1752 -6.0230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1638 -7.5229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8591 -8.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8500 -9.4630 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5658 -7.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5772 -6.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2603 -8.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2269 -7.6336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5531 -8.9633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5401 -10.4633 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 -11.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5703 -9.8480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2346 -11.2020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2241 -12.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0579 -10.4407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1023 -11.0316 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0448 -8.9407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6034 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3101 -0.7432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3215 0.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6262 1.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6406 2.9977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6852 3.5883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9195 0.7371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9081 -0.7629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
9 11 1 0
11 12 2 0
12 6 1 0
11 13 1 0
13 14 1 1
13 15 1 0
15 16 1 0
16 17 2 0
16 18 2 0
16 19 1 0
19 20 1 0
19 21 1 0
21 22 2 0
21 23 1 0
23 13 1 0
4 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 1 0
27 30 1 0
30 31 2 0
31 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 450.50Molecular Weight (Monoisotopic): 450.1486AlogP: 1.66#Rotatable Bonds: 5Polar Surface Area: 129.00Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 4.37CX LogP: 1.37CX LogD: 1.37Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.36Np Likeness Score: -1.09
References 1. (2016) Iminothiadiazine dioxides containing a thioamide, amidine, or amide oxime group as BACE inhibitors, compositions, and their use,