2-(6-(4-hydroxyphenoxy)-5,7-dimethylbenzofuran-3-yl)acetic acid

ID: ALA393914

PubChem CID: 44441138

Max Phase: Preclinical

Molecular Formula: C18H16O5

Molecular Weight: 312.32

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc2c(CC(=O)O)coc2c(C)c1Oc1ccc(O)cc1

Standard InChI:  InChI=1S/C18H16O5/c1-10-7-15-12(8-16(20)21)9-22-18(15)11(2)17(10)23-14-5-3-13(19)4-6-14/h3-7,9,19H,8H2,1-2H3,(H,20,21)

Standard InChI Key:  PVNPRPWRYQGESM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    7.5986   -3.9083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5974   -4.7357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3122   -5.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0287   -4.7352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0258   -3.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3104   -3.4955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7387   -3.4895    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.4547   -3.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4545   -4.7219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1697   -5.1316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1620   -3.4812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8826   -5.1476    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.6641   -3.6248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8767   -3.8863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8832   -4.7166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6761   -4.9655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.1560   -4.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0856   -5.6817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9106   -5.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3201   -6.4014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3261   -4.9725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7406   -5.1355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1546   -2.6562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 14 11  1  0
 11  8  2  0
  5  6  2  0
  2 12  1  0
 14 15  2  0
  6  1  1  0
  1  2  2  0
  5  7  1  0
  3  4  2  0
  7  8  1  0
 13 14  1  0
 15 16  1  0
 16 17  2  0
 17 13  1  0
 16 18  1  0
  8  9  1  0
 18 19  1  0
  4  5  1  0
 19 20  2  0
  9 10  2  0
 19 21  1  0
 10 15  1  0
  9 22  1  0
  2  3  1  0
 11 23  1  0
M  END

Associated Targets(Human)

THRA Tclin Thyroid hormone receptor (146 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 312.32Molecular Weight (Monoisotopic): 312.0998AlogP: 4.17#Rotatable Bonds: 4
Polar Surface Area: 79.90Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.28CX Basic pKa: CX LogP: 3.99CX LogD: 1.01
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.76Np Likeness Score: 0.32

References

1. Haning H, Mueller U, Schmidt G, Schmeck C, Voehringer V, Kretschmer A, Bischoff H..  (2007)  Novel heterocyclic thyromimetics. Part 2.,  17  (14): [PMID:17499989] [10.1016/j.bmcl.2007.04.085]

Source