The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA3939286
PubChem CID: 134149712
Max Phase: Preclinical
Molecular Formula: C28H24F3N7O3S
Molecular Weight: 595.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)N1Cc2cccc(c2)C(=O)N2CCc3cc(ccc32)Nc2ncc(C(F)(F)F)c(n2)NCc2cccnc21
Standard InChI: InChI=1S/C28H24F3N7O3S/c1-42(40,41)38-16-17-4-2-5-19(12-17)26(39)37-11-9-18-13-21(7-8-23(18)37)35-27-34-15-22(28(29,30)31)24(36-27)33-14-20-6-3-10-32-25(20)38/h2-8,10,12-13,15H,9,11,14,16H2,1H3,(H2,33,34,35,36)
Standard InChI Key: VTFLNPMNLYUXBL-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
21.1505 -11.6453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
21.8606 -12.0576 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
21.8627 -11.2365 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.3470 -8.7125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.3459 -9.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0539 -9.9410 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.7636 -9.5316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.7608 -8.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.0521 -8.3037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4642 -8.2977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.1067 -7.9235 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
22.2636 -8.5982 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.5973 -7.4542 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.4720 -9.9380 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.8778 -10.6473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.6949 -10.6506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0954 -11.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9118 -11.3635 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.3241 -10.6569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9139 -9.9452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.0988 -9.9451 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6379 -9.9400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.6657 -10.7567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9721 -11.1876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.4168 -11.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3860 -11.1373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7212 -12.3887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9974 -12.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4099 -12.5763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7706 -13.3113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5810 -13.1952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.6813 -12.0654 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.8526 -12.8645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4509 -12.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.2463 -13.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.4702 -13.1586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8642 -13.7057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.0353 -14.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.8178 -14.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4204 -14.2069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1586 -13.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.9473 -14.5620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 12 1 0
10 13 1 0
8 10 1 0
7 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
17 32 1 0
5 22 1 0
22 23 1 0
23 24 2 0
24 28 1 0
27 25 1 0
25 26 2 0
26 23 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
31 27 1 0
32 2 1 0
32 33 1 0
2 34 1 0
33 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
31 41 1 0
41 42 2 0
41 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 595.61Molecular Weight (Monoisotopic): 595.1613AlogP: 4.73#Rotatable Bonds: 1Polar Surface Area: 120.42Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.27CX Basic pKa: 4.25CX LogP: 3.56CX LogD: 3.56Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: -0.66
References 1. Farand J, Mai N, Chandrasekhar J, Newby ZE, Van Veldhuizen J, Loyer-Drew J, Venkataramani C, Guerrero J, Kwok A, Li N, Zherebina Y, Wilbert S, Zablocki J, Phillips G, Watkins WJ, Mourey R, Notte GT.. (2016) Selectivity switch between FAK and Pyk2: Macrocyclization of FAK inhibitors improves Pyk2 potency., 26 (24): [PMID:27876318 ] [10.1016/j.bmcl.2016.10.092 ]