ID: ALA3939286

PubChem CID: 134149712

Max Phase: Preclinical

Molecular Formula: C28H24F3N7O3S

Molecular Weight: 595.61

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CS(=O)(=O)N1Cc2cccc(c2)C(=O)N2CCc3cc(ccc32)Nc2ncc(C(F)(F)F)c(n2)NCc2cccnc21

Standard InChI:  InChI=1S/C28H24F3N7O3S/c1-42(40,41)38-16-17-4-2-5-19(12-17)26(39)37-11-9-18-13-21(7-8-23(18)37)35-27-34-15-22(28(29,30)31)24(36-27)33-14-20-6-3-10-32-25(20)38/h2-8,10,12-13,15H,9,11,14,16H2,1H3,(H2,33,34,35,36)

Standard InChI Key:  VTFLNPMNLYUXBL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
   21.1505  -11.6453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.8606  -12.0576    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   21.8627  -11.2365    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3470   -8.7125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3459   -9.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0539   -9.9410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7636   -9.5316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7608   -8.7089    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0521   -8.3037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4642   -8.2977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1067   -7.9235    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   22.2636   -8.5982    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.5973   -7.4542    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   21.4720   -9.9380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.8778  -10.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.6949  -10.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0954  -11.3599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9118  -11.3635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.3241  -10.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9139   -9.9452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.0988   -9.9451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6379   -9.9400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.6657  -10.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9721  -11.1876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4168  -11.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3860  -11.1373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7212  -12.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9974  -12.0061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4099  -12.5763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7706  -13.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5810  -13.1952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.6813  -12.0654    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.8526  -12.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4509  -12.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2463  -13.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.4702  -13.1586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8642  -13.7057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.0353  -14.5057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.8178  -14.7557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4204  -14.2069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1586  -13.7726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9473  -14.5620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 10 12  1  0
 10 13  1  0
  8 10  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 17 32  1  0
  5 22  1  0
 22 23  1  0
 23 24  2  0
 24 28  1  0
 27 25  1  0
 25 26  2  0
 26 23  1  0
 27 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 27  1  0
 32  2  1  0
 32 33  1  0
  2 34  1  0
 33 35  1  0
 35 36  2  0
 36 37  1  0
 37 38  2  0
 38 39  1  0
 39 40  2  0
 40 35  1  0
 31 41  1  0
 41 42  2  0
 41 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3939286

    ---

Associated Targets(Human)

PTK2B Tclin Protein tyrosine kinase 2 beta (2827 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PTK2 Tclin Focal adhesion kinase 1 (4730 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 595.61Molecular Weight (Monoisotopic): 595.1613AlogP: 4.73#Rotatable Bonds: 1
Polar Surface Area: 120.42Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.27CX Basic pKa: 4.25CX LogP: 3.56CX LogD: 3.56
Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.32Np Likeness Score: -0.66

References

1. Farand J, Mai N, Chandrasekhar J, Newby ZE, Van Veldhuizen J, Loyer-Drew J, Venkataramani C, Guerrero J, Kwok A, Li N, Zherebina Y, Wilbert S, Zablocki J, Phillips G, Watkins WJ, Mourey R, Notte GT..  (2016)  Selectivity switch between FAK and Pyk2: Macrocyclization of FAK inhibitors improves Pyk2 potency.,  26  (24): [PMID:27876318] [10.1016/j.bmcl.2016.10.092]

Source