US9394303, 58

ID: ALA3940204

PubChem CID: 118423451

Max Phase: Preclinical

Molecular Formula: C29H21N3O4

Molecular Weight: 475.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(Cc2ccc(Oc3cccc4ccccc34)cc2)c2nc(-c3ccco3)cc(C(=O)O)c12

Standard InChI:  InChI=1S/C29H21N3O4/c1-18-27-23(29(33)34)16-24(26-10-5-15-35-26)30-28(27)32(31-18)17-19-11-13-21(14-12-19)36-25-9-4-7-20-6-2-3-8-22(20)25/h2-16H,17H2,1H3,(H,33,34)

Standard InChI Key:  MFKDCHRPNIENCR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
    6.3030    6.2693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0148    5.3033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5609    3.8736    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7802    3.0220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876    1.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9871    3.8897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4564    3.5878    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4526    4.7093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9794    6.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5101    6.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0395    7.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8377    8.7559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8645    8.1034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5139    5.3132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9226    4.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5227    3.0465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0132    3.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3127    4.6855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0075    5.4246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 11  1  0
 20 15  1  0
  9 21  1  0
 21 22  2  0
 22  6  1  0
  4 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 27 31  2  0
 31  2  1  0
 31 23  1  0
 25 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 32  2  0
M  END

Associated Targets(non-human)

Mcl1 Induced myeloid leukemia cell differentiation protein Mcl-1 homolog (108 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bcl2 Apoptosis regulator Bcl-2 (542 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Bcl2l1 Bcl-2-like protein 1 (598 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 475.50Molecular Weight (Monoisotopic): 475.1532AlogP: 6.69#Rotatable Bonds: 6
Polar Surface Area: 90.38Molecular Species: ACIDHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.51CX Basic pKa: 1.78CX LogP: 5.52CX LogD: 2.29
Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.29Np Likeness Score: -1.38

References

1.  (2016)  Small molecule inhibitors of MCL-1 and uses thereof, 

Source

Source(1):