(S)-N-(2-((S)-2-carbamoylpyrrolidin-1-yl)-2-oxoethyl)-5-oxopyrrolidine-2-carboxamide

ID: ALA3940595

Cas Number: 42294-01-9

PubChem CID: 71363192

Max Phase: Preclinical

Molecular Formula: C12H18N4O4

Molecular Weight: 282.30

Molecule Type: Protein

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@@H]1CCC(=O)N1

Standard InChI:  InChI=1S/C12H18N4O4/c13-11(19)8-2-1-5-16(8)10(18)6-14-12(20)7-3-4-9(17)15-7/h7-8H,1-6H2,(H2,13,19)(H,14,20)(H,15,17)/t7-,8-/m0/s1

Standard InChI Key:  XKFFWWWMHGXEPW-YUMQZZPRSA-N

Molfile:  

     RDKit          2D

 20 21  0  0  0  0  0  0  0  0999 V2000
   20.0490   -9.5364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.0670   -9.9815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.8210  -10.1373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.6324   -8.7197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.8414   -7.4943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0416  -10.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3427   -9.9448    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.9262   -9.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.6744   -9.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.6324   -9.5364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6332  -10.2235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8403  -10.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5007   -8.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.0490   -8.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.4514   -9.6846    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.7551   -8.3113    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.6402   -7.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0485   -8.0288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1812   -9.6145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.3427   -8.3113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 18  1  0
 16 13  1  0
  8 19  1  0
  9  2  1  0
 14  1  2  0
 14 16  1  0
 12  8  1  0
 11  3  2  0
 20 14  1  0
  8 10  1  6
  6 12  1  0
 11  6  1  0
 13  9  1  1
  4 20  1  0
  5 16  1  0
 19 11  1  0
  4 10  1  0
 18 17  1  0
 10  7  2  0
  9 15  2  0
 17  5  1  0
M  END

Alternative Forms

Associated Targets(non-human)

TRHDE Thyrotropin releasing hormone degrading enzyme (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 282.30Molecular Weight (Monoisotopic): 282.1328AlogP: -2.14#Rotatable Bonds: 4
Polar Surface Area: 121.60Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 11.28CX Basic pKa: CX LogP: -3.07CX LogD: -3.07
Aromatic Rings: Heavy Atoms: 20QED Weighted: 0.54Np Likeness Score: -1.06

References

1.  (2010)  TRH-like peptide derivatives as inhibitors of the TRH-degrading ectoenzyme, 

Source