(S)-1-((S)-1-((S)-5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl)pyrrolidine-2-carboxamide

ID: ALA3941076

Cas Number: 78058-04-5

PubChem CID: 13312509

Max Phase: Preclinical

Molecular Formula: C15H22N4O4

Molecular Weight: 322.37

Molecule Type: Protein

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCC(=O)N1

Standard InChI:  InChI=1S/C15H22N4O4/c16-13(21)10-3-1-7-18(10)15(23)11-4-2-8-19(11)14(22)9-5-6-12(20)17-9/h9-11H,1-8H2,(H2,16,21)(H,17,20)/t9-,10-,11-/m0/s1

Standard InChI Key:  HNEABOKGLREENG-DCAQKATOSA-N

Molfile:  

     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
    8.8345  -17.3989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8058  -16.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5197  -15.7042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8058  -16.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3780  -16.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6599  -17.3541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0919  -17.3541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9070  -17.0263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3563  -17.6383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7710  -18.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5778  -18.1798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5359  -17.5517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2731  -16.0364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4477  -16.8428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2329  -17.0968    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3757  -16.1148    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.0890  -15.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9228  -14.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1067  -14.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7687  -15.5620    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6030  -14.8834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4093  -14.7090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8244  -15.4219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 17  2  1  1
  2  3  1  0
  2  4  2  0
 16  5  1  0
  6  5  1  6
  5  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  6  1  0
  9 12  2  0
 13 14  1  1
 14 15  2  0
 14  1  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
  3 21  1  0
 13  3  1  0
 13 23  1  0
 21 22  1  0
 22 23  1  0
M  END

Alternative Forms

Associated Targets(non-human)

TRHDE Thyrotropin releasing hormone degrading enzyme (95 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.37Molecular Weight (Monoisotopic): 322.1641AlogP: -1.27#Rotatable Bonds: 3
Polar Surface Area: 112.81Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.38CX Basic pKa: CX LogP: -2.22CX LogD: -2.22
Aromatic Rings: Heavy Atoms: 23QED Weighted: 0.67Np Likeness Score: -0.51

References

1.  (2010)  TRH-like peptide derivatives as inhibitors of the TRH-degrading ectoenzyme, 

Source