US9359371, 47

ID: ALA3941090

PubChem CID: 73214250

Max Phase: Preclinical

Molecular Formula: C26H34ClN5O3

Molecular Weight: 500.04

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(CNc2nc(N3CCC4(CC4)C3)ncc2C(=O)NCC2CCC(O)CC2)cc1Cl

Standard InChI:  InChI=1S/C26H34ClN5O3/c1-35-22-7-4-18(12-21(22)27)14-28-23-20(24(34)29-13-17-2-5-19(33)6-3-17)15-30-25(31-23)32-11-10-26(16-32)8-9-26/h4,7,12,15,17,19,33H,2-3,5-6,8-11,13-14,16H2,1H3,(H,29,34)(H,28,30,31)

Standard InChI Key:  QNVSPXGOOGMOHU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -3.4394   11.4368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2766   10.5771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8700    9.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4155    8.7654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0061    7.3224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0511    6.2462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6444    4.8016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6915    3.7263    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2848    2.2817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8304    1.9147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4232    0.4763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4660   -0.6044    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9204   -0.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3298    1.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7858    1.5697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1154    2.7236    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8298    0.4915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2858    0.8557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3298   -0.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7856    0.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8268   -0.9404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4124   -2.3820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.2454   -3.2458    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.9567   -2.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9155   -1.6642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4527   -1.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9615   -1.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4293    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9079   -0.3018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4251    1.1166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2071    0.8600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5056    6.6133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9150    8.0563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0785    8.3499    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14  9  1  0
 14 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 25 19  1  0
 11 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 29  1  0
 29 32  1  0
 32 26  1  0
  6 33  1  0
 33 34  2  0
 34  3  1  0
 34 35  1  0
M  END

Associated Targets(Human)

PDE11A Tchem Phosphodiesterase 11A (449 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.04Molecular Weight (Monoisotopic): 499.2350AlogP: 4.02#Rotatable Bonds: 8
Polar Surface Area: 99.61Molecular Species: NEUTRALHBA: 7HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.60CX LogP: 4.21CX LogD: 4.20
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.50Np Likeness Score: -0.95

References

1.  (2016)  Bicyclic substituted pyrimidine compounds, 

Source

Source(1):