The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9359371, 47 ID: ALA3941090
PubChem CID: 73214250
Max Phase: Preclinical
Molecular Formula: C26H34ClN5O3
Molecular Weight: 500.04
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNc2nc(N3CCC4(CC4)C3)ncc2C(=O)NCC2CCC(O)CC2)cc1Cl
Standard InChI: InChI=1S/C26H34ClN5O3/c1-35-22-7-4-18(12-21(22)27)14-28-23-20(24(34)29-13-17-2-5-19(33)6-3-17)15-30-25(31-23)32-11-10-26(16-32)8-9-26/h4,7,12,15,17,19,33H,2-3,5-6,8-11,13-14,16H2,1H3,(H,29,34)(H,28,30,31)
Standard InChI Key: QNVSPXGOOGMOHU-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-3.4394 11.4368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2766 10.5771 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8700 9.1324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4155 8.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0061 7.3224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0511 6.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6444 4.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6915 3.7263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2848 2.2817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8304 1.9147 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4232 0.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4660 -0.6044 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9204 -0.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3298 1.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7858 1.5697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1154 2.7236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.8298 0.4915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.2858 0.8557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.3298 -0.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7856 0.1393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.8268 -0.9404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.4124 -2.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.2454 -3.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.9567 -2.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.9155 -1.6642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4527 -1.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9615 -1.4334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4293 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9079 -0.3018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4251 1.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2071 0.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5056 6.6133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9150 8.0563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0785 8.3499 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
22 24 1 0
24 25 1 0
25 19 1 0
11 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 29 1 0
29 32 1 0
32 26 1 0
6 33 1 0
33 34 2 0
34 3 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.04Molecular Weight (Monoisotopic): 499.2350AlogP: 4.02#Rotatable Bonds: 8Polar Surface Area: 99.61Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 5.60CX LogP: 4.21CX LogD: 4.20Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.50Np Likeness Score: -0.95
References 1. (2016) Bicyclic substituted pyrimidine compounds,