US9238658, 63

ID: ALA3941107

PubChem CID: 89626930

Max Phase: Preclinical

Molecular Formula: C19H19FN4O3S

Molecular Weight: 402.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(Nc1nc2c(s1)COCC2)N1CCC(c2noc3ccc(F)cc23)CC1

Standard InChI:  InChI=1S/C19H19FN4O3S/c20-12-1-2-15-13(9-12)17(23-27-15)11-3-6-24(7-4-11)19(25)22-18-21-14-5-8-26-10-16(14)28-18/h1-2,9,11H,3-8,10H2,(H,21,22,25)

Standard InChI Key:  BUZUDCIRABIRLU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248    1.2135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6065    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7248   -1.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1884   -2.6409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6234   -3.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9781   -4.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8933   -5.5536    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4537   -5.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0990   -3.6745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2452   -7.0125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3962   -7.3518    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1582   -8.0475    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5101   -9.5065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5343  -10.6289    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3218  -11.9046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9003  -13.3441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9362  -14.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3936  -14.0743    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8152  -12.6347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7793  -11.5499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8926  -10.0550    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14  9  1  0
 12 15  1  0
 15 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 20  2  0
 25 26  1  0
 26 18  1  0
  8 27  1  0
 27  5  1  0
 27 28  2  0
 28  2  1  0
M  END

Associated Targets(non-human)

Scd1 Acyl-CoA desaturase 1 (506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 402.45Molecular Weight (Monoisotopic): 402.1162AlogP: 3.91#Rotatable Bonds: 2
Polar Surface Area: 80.49Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 7.77CX Basic pKa: CX LogP: 2.67CX LogD: 2.53
Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.70Np Likeness Score: -2.16

References

1.  (2016)  Substituted piperidinyl-carboxamide derivatives useful as SCD 1 inhibitors, 

Source

Source(1):