3-(1-{5-[9-(4-Methoxyphenyl)-9H-fluoren-9-yloxy]pentyl}-1H-imidazol-2-yl)propanoic acid

ID: ALA3941169

PubChem CID: 134145899

Max Phase: Preclinical

Molecular Formula: C31H32N2O4

Molecular Weight: 496.61

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1ccc(C2(OCCCCCn3ccnc3CCC(=O)O)c3ccccc3-c3ccccc32)cc1

Standard InChI:  InChI=1S/C31H32N2O4/c1-36-24-15-13-23(14-16-24)31(27-11-5-3-9-25(27)26-10-4-6-12-28(26)31)37-22-8-2-7-20-33-21-19-32-29(33)17-18-30(34)35/h3-6,9-16,19,21H,2,7-8,17-18,20,22H2,1H3,(H,34,35)

Standard InChI Key:  CTWSBOSWNLVAIR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
   10.0791  -21.8869    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8625  -21.6543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8853  -20.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1125  -20.5638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6183  -21.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5591  -20.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4956  -19.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1694  -19.0979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1059  -18.2832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.9068  -19.4502    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6761  -25.7522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2676  -24.1118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9735  -24.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9701  -25.3406    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.2675  -27.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0208  -26.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2286  -26.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6822  -26.6657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9335  -27.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7252  -27.6102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3390  -26.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0838  -27.0106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6279  -27.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4274  -27.4499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6799  -26.6694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1340  -26.0655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3793  -25.3371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0899  -25.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7927  -25.3270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7852  -24.5096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0691  -24.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3694  -24.5251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4884  -24.0932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2005  -24.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2710  -23.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5650  -22.8830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5685  -22.0659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  1  2  0
  3  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  2  0
 15 22  1  0
 21 11  1  0
 11 16  1  0
 12 13  1  0
 13 14  1  0
 14 11  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 21  1  0
 11 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 27  1  0
 30 33  1  0
 33 34  1  0
 12 35  1  0
 35 36  1  0
 36 37  1  0
 37  2  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3941169

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 496.61

Molecular Weight (Monoisotopic): 496.2362

AlogP: 6.07

#Rotatable Bonds: 12

Polar Surface Area: 73.58

Molecular Species: ACID

HBA: 5

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 4.26

CX Basic pKa: 6.14

CX LogP: 4.47

CX LogD: 3.23

Aromatic Rings: 4

Heavy Atoms: 37

QED Weighted: 0.24

Np Likeness Score: -0.28

References

1. Kerscher-Hack S, Renukappa-Gutke T, Höfner G, Wanner KT..  (2016)  Synthesis and biological evaluation of a series of N-alkylated imidazole alkanoic acids as mGAT3 selective GABA uptake inhibitors.,  124  [PMID:27654218] [10.1016/j.ejmech.2016.09.012]

Source

Source(1):

• Scientific Literature