The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Propane-1-sulfonic acid (2,4-difluoro-3-{5-[6-(3-pyrrolidin-1-yl-propoxy)-pyridin-3-yl]-1H-pyrrolo[2,3-b]pyridine-3-carbonyl}-phenyl)-amide ID: ALA3941565
PubChem CID: 49779915
Max Phase: Preclinical
Molecular Formula: C29H31F2N5O4S
Molecular Weight: 583.66
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4ccc(OCCCN5CCCC5)nc4)cc23)c1F
Standard InChI: InChI=1S/C29H31F2N5O4S/c1-2-14-41(38,39)35-24-8-7-23(30)26(27(24)31)28(37)22-18-34-29-21(22)15-20(17-33-29)19-6-9-25(32-16-19)40-13-5-12-36-10-3-4-11-36/h6-9,15-18,35H,2-5,10-14H2,1H3,(H,33,34)
Standard InChI Key: UJQYWQCKAHYIAY-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
11.2558 -22.7058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2838 -23.5252 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
11.9795 -23.0912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4183 -23.0789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4165 -23.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1245 -24.3079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.1227 -22.6706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8314 -23.0758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8362 -23.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6206 -24.1488 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1006 -23.4800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6128 -22.8169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0212 -22.1098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8384 -22.1101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6129 -21.4019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2439 -22.8188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0604 -22.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4700 -22.1114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0573 -21.4012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2422 -21.4040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8310 -20.6978 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.8337 -23.5256 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.4684 -23.5275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.6935 -24.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5107 -24.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9187 -24.9450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7137 -22.6735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7152 -21.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0085 -21.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2997 -21.8550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3021 -22.6764 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0094 -23.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5915 -21.4471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8842 -21.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8851 -22.6737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1778 -23.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1787 -23.9002 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5190 -24.3855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7723 -25.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5896 -25.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8412 -24.3840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 14 1 0
20 21 1 0
16 22 1 0
17 23 1 0
23 2 1 0
2 24 1 0
24 25 1 0
25 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
4 27 1 0
30 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.66Molecular Weight (Monoisotopic): 583.2065AlogP: 5.15#Rotatable Bonds: 12Polar Surface Area: 117.28Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 8.67CX Basic pKa: 9.30CX LogP: 3.00CX LogD: 1.96Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.17Np Likeness Score: -1.57
References 1. (2012) Compounds and methods for kinase modulation, and indications thereof,