The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Propane-1-sulfonic acid {3-[5-(2-dimethylamino-pyrimidin-5-yl)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]-2,4-difluoro-phenyl}-amide ID: ALA3942381
PubChem CID: 49779659
Max Phase: Preclinical
Molecular Formula: C23H22F2N6O3S
Molecular Weight: 500.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCS(=O)(=O)Nc1ccc(F)c(C(=O)c2c[nH]c3ncc(-c4cnc(N(C)C)nc4)cc23)c1F
Standard InChI: InChI=1S/C23H22F2N6O3S/c1-4-7-35(33,34)30-18-6-5-17(24)19(20(18)25)21(32)16-12-27-22-15(16)8-13(9-26-22)14-10-28-23(29-11-14)31(2)3/h5-6,8-12,30H,4,7H2,1-3H3,(H,26,27)
Standard InChI Key: CNMJRJRTAYPAML-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
10.1745 -15.8092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.2025 -16.6286 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.8981 -16.1946 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3370 -16.1823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3352 -17.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0432 -17.4113 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0414 -15.7740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7500 -16.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7549 -17.0024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5392 -17.2522 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0192 -16.5834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5314 -15.9203 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9399 -15.2132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7571 -15.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5316 -14.5053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.1626 -15.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9790 -15.9229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3887 -15.2148 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9760 -14.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1609 -14.5074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7496 -13.8012 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
7.7524 -16.6290 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3870 -16.6309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.6122 -17.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4294 -17.3404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8374 -18.0484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6323 -15.7769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6339 -14.9586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9271 -14.5499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2183 -14.9584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2207 -15.7798 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9281 -16.1848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5102 -14.5505 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5093 -13.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8029 -14.9599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 9 2 0
8 7 2 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
13 15 2 0
14 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 14 1 0
20 21 1 0
16 22 1 0
17 23 1 0
23 2 1 0
2 24 1 0
24 25 1 0
25 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 27 2 0
4 27 1 0
30 33 1 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.53Molecular Weight (Monoisotopic): 500.1442AlogP: 3.75#Rotatable Bonds: 8Polar Surface Area: 120.94Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.87CX Basic pKa: 2.87CX LogP: 2.88CX LogD: 2.87Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.35Np Likeness Score: -1.33
References 1. (2012) Compounds and methods for kinase modulation, and indications thereof,