3-(2,4-dimethoxyphenyl)-2-(4-methoxybenzylthio)-6-methylquinazolin-4(3H)-one

ID: ALA3942503

PubChem CID: 134146706

Max Phase: Preclinical

Molecular Formula: C25H24N2O4S

Molecular Weight: 448.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CSc2nc3ccc(C)cc3c(=O)n2-c2ccc(OC)cc2OC)cc1

Standard InChI:  InChI=1S/C25H24N2O4S/c1-16-5-11-21-20(13-16)24(28)27(22-12-10-19(30-3)14-23(22)31-4)25(26-21)32-15-17-6-8-18(29-2)9-7-17/h5-14H,15H2,1-4H3

Standard InChI Key:  DVPZOCAYJZREPZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   72.9919   -3.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.9907   -3.8892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.7055   -4.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.7037   -2.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.4191   -3.0582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.4199   -3.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   75.1352   -4.2960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   75.8502   -3.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   75.8454   -3.0513    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   75.1296   -2.6441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   76.5544   -2.6362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.2717   -3.0460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.9831   -2.6299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.9785   -1.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.2565   -1.3961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   76.5480   -1.8146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   76.5663   -4.2910    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   76.5695   -5.1160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.2856   -5.5257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.2854   -6.3505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   78.0006   -6.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   78.7145   -6.3448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   78.7086   -5.5155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   77.9928   -5.1096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   75.1252   -1.8191    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   79.4311   -6.7535    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   80.1434   -6.3373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.2773   -2.6495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   75.8300   -1.4084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   78.6899   -1.3862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   79.4074   -1.7934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   75.8227   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
  1 28  1  0
 16 29  1  0
 14 30  1  0
 30 31  1  0
 29 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3942503

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.54Molecular Weight (Monoisotopic): 448.1457AlogP: 5.01#Rotatable Bonds: 7
Polar Surface Area: 62.58Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 5.69CX LogD: 5.69
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.29Np Likeness Score: -1.36

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source