The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6,7-dimethoxy-2-(4-methoxybenzylthio)-3-(4-methoxyphenyl)quinazolin-4(3H)-one ID: ALA3944367
PubChem CID: 134146044
Max Phase: Preclinical
Molecular Formula: C25H24N2O5S
Molecular Weight: 464.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CSc2nc3cc(OC)c(OC)cc3c(=O)n2-c2ccc(OC)cc2)cc1
Standard InChI: InChI=1S/C25H24N2O5S/c1-29-18-9-5-16(6-10-18)15-33-25-26-21-14-23(32-4)22(31-3)13-20(21)24(28)27(25)17-7-11-19(30-2)12-8-17/h5-14H,15H2,1-4H3
Standard InChI Key: VFTVNGBIJHUGFI-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
47.8394 -21.5117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.8382 -22.3390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.5530 -22.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
48.5512 -21.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.2666 -21.5080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.2674 -22.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.9827 -22.7458 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
50.6977 -22.3311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
50.6929 -21.5011 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
49.9771 -21.0939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4019 -21.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1192 -21.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.8306 -21.0797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.8260 -20.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1040 -19.8459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.3955 -20.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
51.4138 -22.7408 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
51.4170 -23.5658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1331 -23.9755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.1329 -24.8003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.8481 -25.2099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.5620 -24.7946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.5561 -23.9654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
52.8403 -23.5595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
49.9727 -20.2689 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
54.2786 -25.2034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
54.9909 -24.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
47.1248 -21.0993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.1234 -22.7510 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
47.1246 -20.2743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
46.4093 -22.3379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
53.5374 -19.8361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
54.2549 -20.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 5 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 11 1 0
9 11 1 0
8 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
10 25 2 0
22 26 1 0
26 27 1 0
1 28 1 0
2 29 1 0
28 30 1 0
29 31 1 0
14 32 1 0
32 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.54Molecular Weight (Monoisotopic): 464.1406AlogP: 4.71#Rotatable Bonds: 8Polar Surface Area: 71.81Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.02CX LogD: 5.02Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.16
References 1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI.. (2016) Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates., 26 (19): [PMID:27554444 ] [10.1016/j.bmcl.2016.08.022 ]