6,7-dimethoxy-2-(4-methoxybenzylthio)-3-(4-methoxyphenyl)quinazolin-4(3H)-one

ID: ALA3944367

PubChem CID: 134146044

Max Phase: Preclinical

Molecular Formula: C25H24N2O5S

Molecular Weight: 464.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CSc2nc3cc(OC)c(OC)cc3c(=O)n2-c2ccc(OC)cc2)cc1

Standard InChI:  InChI=1S/C25H24N2O5S/c1-29-18-9-5-16(6-10-18)15-33-25-26-21-14-23(32-4)22(31-3)13-20(21)24(28)27(25)17-7-11-19(30-2)12-8-17/h5-14H,15H2,1-4H3

Standard InChI Key:  VFTVNGBIJHUGFI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   47.8394  -21.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.8382  -22.3390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.5530  -22.7519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   48.5512  -21.0989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.2666  -21.5080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.2674  -22.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.9827  -22.7458    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   50.6977  -22.3311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   50.6929  -21.5011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   49.9771  -21.0939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.4019  -21.0860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.1192  -21.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.8306  -21.0797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.8260  -20.2539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.1040  -19.8459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.3955  -20.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.4138  -22.7408    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   51.4170  -23.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.1331  -23.9755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.1329  -24.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.8481  -25.2099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.5620  -24.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.5561  -23.9654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.8403  -23.5595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   49.9727  -20.2689    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   54.2786  -25.2034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   54.9909  -24.7872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.1248  -21.0993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.1234  -22.7510    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   47.1246  -20.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4093  -22.3379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.5374  -19.8361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   54.2549  -20.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
  1 28  1  0
  2 29  1  0
 28 30  1  0
 29 31  1  0
 14 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3944367

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 464.54Molecular Weight (Monoisotopic): 464.1406AlogP: 4.71#Rotatable Bonds: 8
Polar Surface Area: 71.81Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 5.02CX LogD: 5.02
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.28Np Likeness Score: -1.16

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source