US9173869, 43

ID: ALA3944577

PubChem CID: 134146650

Max Phase: Preclinical

Molecular Formula: C27H24Cl2FN5O2

Molecular Weight: 540.43

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(c1nc2ccccc2c(=O)n1-c1ccc(F)cc1)N1CCN(C(=O)Nc2ccc(Cl)c(Cl)c2)CC1

Standard InChI:  InChI=1S/C27H24Cl2FN5O2/c1-17(33-12-14-34(15-13-33)27(37)31-19-8-11-22(28)23(29)16-19)25-32-24-5-3-2-4-21(24)26(36)35(25)20-9-6-18(30)7-10-20/h2-11,16-17H,12-15H2,1H3,(H,31,37)

Standard InChI Key:  OQRDESWYDGGRFT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    2.6024   -2.6977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2007   -1.4909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4972   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4920    0.7636    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1903    1.5091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    0.7546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876    1.5211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8299    0.9266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7802    3.0220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.0758    3.7795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0707    5.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3671    6.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6688    5.2886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7059    5.8922    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.6740    3.7886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7153    3.1922    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   10.3776    3.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    3.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    3.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5981    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383   -1.3500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2978   -3.7529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2955   -5.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048   -6.0009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0067   -7.2009    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.3026   -5.2488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3002   -3.7488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  3  1  0
  6  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  2  0
 19 12  1  0
  2 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 27 28  1  0
 28 29  2  0
 28 30  1  0
 30 20  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 34 36  1  0
 36 37  2  0
 37 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3944577

    ---

Associated Targets(non-human)

Shh Sonic hedgehog protein (356 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 540.43Molecular Weight (Monoisotopic): 539.1291AlogP: 5.74#Rotatable Bonds: 4
Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 13.12CX Basic pKa: 4.84CX LogP: 5.45CX LogD: 5.45
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.83

References

1.  (2015)  Mediators of hedgehog signaling pathways, compositions and uses related thereto, 

Source

Source(1):