The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9173869, 43 ID: ALA3944577
PubChem CID: 134146650
Max Phase: Preclinical
Molecular Formula: C27H24Cl2FN5O2
Molecular Weight: 540.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(c1nc2ccccc2c(=O)n1-c1ccc(F)cc1)N1CCN(C(=O)Nc2ccc(Cl)c(Cl)c2)CC1
Standard InChI: InChI=1S/C27H24Cl2FN5O2/c1-17(33-12-14-34(15-13-33)27(37)31-19-8-11-22(28)23(29)16-19)25-32-24-5-3-2-4-21(24)26(36)35(25)20-9-6-18(30)7-10-20/h2-11,16-17H,12-15H2,1H3,(H,31,37)
Standard InChI Key: OQRDESWYDGGRFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
2.6024 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2007 -1.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4972 -0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4920 0.7636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1903 1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8939 0.7546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 1.5211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8299 0.9266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7802 3.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0758 3.7795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0707 5.2796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3671 6.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6688 5.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7059 5.8922 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11.6740 3.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7153 3.1922 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.3776 3.0341 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -7.2009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 3 1 0
6 9 1 0
9 10 2 0
9 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
15 17 1 0
17 18 1 0
17 19 2 0
19 12 1 0
2 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
27 28 1 0
28 29 2 0
28 30 1 0
30 20 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
34 36 1 0
36 37 2 0
37 31 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 540.43Molecular Weight (Monoisotopic): 539.1291AlogP: 5.74#Rotatable Bonds: 4Polar Surface Area: 70.47Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.12CX Basic pKa: 4.84CX LogP: 5.45CX LogD: 5.45Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.36Np Likeness Score: -1.83
References 1. (2015) Mediators of hedgehog signaling pathways, compositions and uses related thereto,