The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447087, 112::US9447087, 97 ID: ALA3944705
PubChem CID: 46926069
Max Phase: Preclinical
Molecular Formula: C20H17ClN8O3
Molecular Weight: 452.86
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2ccon2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C20H17ClN8O3/c1-10-15(18(30)24-14-7-8-31-28-14)17(16-11(21)9-29(2)27-16)25-19(22-10)26-20-23-12-5-3-4-6-13(12)32-20/h3-9,17H,1-2H3,(H,24,28,30)(H2,22,23,25,26)
Standard InChI Key: ZNYWPNZSBIAKOL-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
-1.6572 -7.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5341 -9.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0147 -9.7621 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3238 -11.2299 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4192 -11.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0234 -11.9775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9106 -10.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7349 -11.2120 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -9.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6640 -9.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2838 -10.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4685 -12.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1479 -13.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9703 -14.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2668 -13.8115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9498 -12.3453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 8 2 0
6 17 1 0
17 2 1 0
4 18 1 0
18 19 2 0
19 20 1 0
20 21 1 0
20 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.86Molecular Weight (Monoisotopic): 452.1112AlogP: 3.23#Rotatable Bonds: 4Polar Surface Area: 135.40Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.95CX Basic pKa: 3.89CX LogP: 2.56CX LogD: 2.55Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.63
References 1. (2016) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 2. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,