US9447087, 112::US9447087, 97

ID: ALA3944705

PubChem CID: 46926069

Max Phase: Preclinical

Molecular Formula: C20H17ClN8O3

Molecular Weight: 452.86

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)Nc2ccon2)C(c2nn(C)cc2Cl)N=C(Nc2nc3ccccc3o2)N1

Standard InChI:  InChI=1S/C20H17ClN8O3/c1-10-15(18(30)24-14-7-8-31-28-14)17(16-11(21)9-29(2)27-16)25-19(22-10)26-20-23-12-5-3-4-6-13(12)32-20/h3-9,17H,1-2H3,(H,24,28,30)(H2,22,23,25,26)

Standard InChI Key:  ZNYWPNZSBIAKOL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -1.6572   -7.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4572   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2883   -8.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5428   -7.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2973   -5.7159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5341   -9.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0147   -9.7621    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3238  -11.2299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4192  -11.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0234  -11.9775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9106  -10.9717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7349  -11.2120    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.4640   -9.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6640   -9.6106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2838  -10.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4685  -12.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1479  -13.5662    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9703  -14.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2668  -13.8115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9498  -12.3453    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16  8  2  0
  6 17  1  0
 17  2  1  0
  4 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
  3 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
 32 28  2  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.86Molecular Weight (Monoisotopic): 452.1112AlogP: 3.23#Rotatable Bonds: 4
Polar Surface Area: 135.40Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.95CX Basic pKa: 3.89CX LogP: 2.56CX LogD: 2.55
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.43Np Likeness Score: -1.63

References

1.  (2016)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 
2.  (2019)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,