The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9447087, 90 ID: ALA3945755
PubChem CID: 46926059
Max Phase: Preclinical
Molecular Formula: C25H20BrN5O2
Molecular Weight: 502.37
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(C(=O)Nc2ccccc2)C(c2ccccc2Br)N=C(Nc2nc3ccccc3o2)N1
Standard InChI: InChI=1S/C25H20BrN5O2/c1-15-21(23(32)28-16-9-3-2-4-10-16)22(17-11-5-6-12-18(17)26)30-24(27-15)31-25-29-19-13-7-8-14-20(19)33-25/h2-14,22H,1H3,(H,28,32)(H2,27,29,30,31)
Standard InChI Key: JNOCEQIKWOYCPO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-1.6572 -7.0081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4572 -7.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2883 -8.3139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7883 -8.3192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5428 -7.0227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7974 -5.7210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5497 -4.4224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2973 -5.7159 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5341 -9.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0342 -9.6244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7817 -10.9248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0293 -12.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5293 -12.2196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7817 -10.9192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5817 -10.9169 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-0.4640 -9.6126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6640 -9.6106 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2838 -10.9139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4685 -12.2126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2770 -13.5143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4775 -14.8108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9775 -14.8056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7230 -13.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9685 -12.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 8 2 0
6 17 1 0
17 2 1 0
4 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 18 1 0
23 24 1 0
3 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 502.37Molecular Weight (Monoisotopic): 501.0800AlogP: 5.62#Rotatable Bonds: 4Polar Surface Area: 91.55Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.61CX Basic pKa: 4.15CX LogP: 5.10CX LogD: 5.10Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.05
References 1. (2016) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 2. (2019) Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,