US9447087, 90

ID: ALA3945755

PubChem CID: 46926059

Max Phase: Preclinical

Molecular Formula: C25H20BrN5O2

Molecular Weight: 502.37

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(C(=O)Nc2ccccc2)C(c2ccccc2Br)N=C(Nc2nc3ccccc3o2)N1

Standard InChI:  InChI=1S/C25H20BrN5O2/c1-15-21(23(32)28-16-9-3-2-4-10-16)22(17-11-5-6-12-18(17)26)30-24(27-15)31-25-29-19-13-7-8-14-20(19)33-25/h2-14,22H,1H3,(H,28,32)(H2,27,29,30,31)

Standard InChI Key:  JNOCEQIKWOYCPO-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -1.6572   -7.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4572   -7.0123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2883   -8.3139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7883   -8.3192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5428   -7.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7974   -5.7210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5497   -4.4224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8032   -3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4133   -1.7530    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3114   -2.9665    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2973   -5.7159    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5341   -9.6214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0342   -9.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7817  -10.9248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0293  -12.2225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5293  -12.2196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7817  -10.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5817  -10.9169    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -0.4640   -9.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6640   -9.6106    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2838  -10.9139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4685  -12.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2770  -13.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4775  -14.8108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9775  -14.8056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7230  -13.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9685  -12.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
 16  8  2  0
  6 17  1  0
 17  2  1  0
  4 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 18  1  0
 23 24  1  0
  3 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
M  END

Associated Targets(Human)

GALK1 Tbio Galactokinase (959 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.37Molecular Weight (Monoisotopic): 501.0800AlogP: 5.62#Rotatable Bonds: 4
Polar Surface Area: 91.55Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.61CX Basic pKa: 4.15CX LogP: 5.10CX LogD: 5.10
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.34Np Likeness Score: -1.05

References

1.  (2016)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders, 
2.  (2019)  Galactokinase inhibitors for the treatment and prevention of associated diseases and disorders,