The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9359371, 14 ID: ALA3945848
PubChem CID: 73214546
Max Phase: Preclinical
Molecular Formula: C26H30ClN7O2
Molecular Weight: 508.03
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(CNc2nc(N3CCC4(CCC4)CC3)ncc2C(=O)NCc2ncccn2)cc1Cl
Standard InChI: InChI=1S/C26H30ClN7O2/c1-36-21-5-4-18(14-20(21)27)15-30-23-19(24(35)31-17-22-28-10-3-11-29-22)16-32-25(33-23)34-12-8-26(9-13-34)6-2-7-26/h3-5,10-11,14,16H,2,6-9,12-13,15,17H2,1H3,(H,31,35)(H,30,32,33)
Standard InChI Key: QMKYSIPXVNLFRI-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
6.1779 -10.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7755 -9.0801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0230 -7.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5230 -7.7872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7682 -6.4909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5133 -5.1890 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7607 -3.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5082 -2.5891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7556 -1.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2556 -1.2961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5007 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2459 1.3019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7459 1.3075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5007 0.0113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0015 0.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6072 -1.0160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7453 1.3235 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.2461 1.3322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9898 2.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4898 2.6467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.2304 3.9511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4711 5.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9711 5.2339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2305 3.9295 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7535 1.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2606 1.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0141 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0691 -1.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1391 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0691 1.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2606 -1.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7535 -1.2961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0134 -5.1836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7682 -6.4798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9682 -6.4754 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 19 1 0
11 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 28 1 0
28 32 1 0
32 33 1 0
33 25 1 0
6 34 1 0
34 35 2 0
35 3 1 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.03Molecular Weight (Monoisotopic): 507.2150AlogP: 4.24#Rotatable Bonds: 8Polar Surface Area: 105.16Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.74CX Basic pKa: 5.61CX LogP: 4.45CX LogD: 4.44Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -1.34
References 1. (2016) Bicyclic substituted pyrimidine compounds,