The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-{4-[(4-Chloro-phenyl)-phenyl-methyl]-piperazin-1-yl}-3,3-diphenyl-propan-1-one hydrochloride ID: ALA3946261
PubChem CID: 134147626
Max Phase: Preclinical
Molecular Formula: C32H32Cl2N2O
Molecular Weight: 495.07
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.O=C(CC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1
Standard InChI: InChI=1S/C32H31ClN2O.ClH/c33-29-18-16-28(17-19-29)32(27-14-8-3-9-15-27)35-22-20-34(21-23-35)31(36)24-30(25-10-4-1-5-11-25)26-12-6-2-7-13-26;/h1-19,30,32H,20-24H2;1H
Standard InChI Key: YZINWUALFFCGMT-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
24.7735 -10.6747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -11.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7735 -12.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9491 -10.6747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -12.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0102 -12.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4224 -13.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0102 -14.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -14.2433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7735 -13.5279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9491 -12.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5369 -12.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7124 -12.8167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.3002 -12.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7124 -11.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.5369 -11.3860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -9.9593 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
24.7735 -9.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -8.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0102 -8.5328 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
26.4224 -9.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0102 -9.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4224 -7.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.2468 -7.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6590 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4834 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.8956 -7.8174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
28.4834 -8.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
27.6590 -8.5328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0102 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -7.1021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7735 -6.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.1857 -5.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.0102 -5.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
26.4224 -6.3908 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.7735 -4.9602 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
22.7052 -14.7440 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
3 5 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
3 11 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
23 24 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 35 1 0
30 35 2 0
33 36 1 0
23 30 1 0
20 23 1 0
1 17 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 495.07Molecular Weight (Monoisotopic): 494.2125AlogP: 6.80#Rotatable Bonds: 7Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.36CX LogP: 7.08CX LogD: 7.04Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.93
References 1. (2004) Calcium channel inhibitors comprising benzhydril spaced from piperazine,