1-{4-[(4-Chloro-phenyl)-phenyl-methyl]-piperazin-1-yl}-3,3-diphenyl-propan-1-one hydrochloride

ID: ALA3946261

PubChem CID: 134147626

Max Phase: Preclinical

Molecular Formula: C32H32Cl2N2O

Molecular Weight: 495.07

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cl.O=C(CC(c1ccccc1)c1ccccc1)N1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1

Standard InChI:  InChI=1S/C32H31ClN2O.ClH/c33-29-18-16-28(17-19-29)32(27-14-8-3-9-15-27)35-22-20-34(21-23-35)31(36)24-30(25-10-4-1-5-11-25)26-12-6-2-7-13-26;/h1-19,30,32H,20-24H2;1H

Standard InChI Key:  YZINWUALFFCGMT-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   24.7735  -10.6747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857  -11.3860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7735  -12.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9491  -10.6747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857  -12.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0102  -12.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4224  -13.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0102  -14.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857  -14.2433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7735  -13.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.9491  -12.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5369  -12.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7124  -12.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.3002  -12.1014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7124  -11.3860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.5369  -11.3860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857   -9.9593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   24.7735   -9.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857   -8.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0102   -8.5328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   26.4224   -9.2440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0102   -9.9593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4224   -7.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.2468   -7.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6590   -7.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4834   -7.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.8956   -7.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.4834   -8.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.6590   -8.5328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0102   -7.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857   -7.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7735   -6.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.1857   -5.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.0102   -5.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   26.4224   -6.3908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7735   -4.9602    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   22.7052  -14.7440    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
  5 10  2  0
  3  5  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
  3 11  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
 23 24  1  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 30 35  2  0
 33 36  1  0
 23 30  1  0
 20 23  1  0
  1 17  1  0
M  END

Associated Targets(Human)

CACNA2D1 Tclin Voltage-dependent L-type calcium channel alpha1C/alpha2delta/beta1b (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CACNA2D1 Tclin Voltage-dependent P/Q-type calcium channel alpha1A/alpha2delta/beta1b (6 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Cacna2d2 Voltage-dependent N-type calcium channel alpha1B/alpha2b/beta1b (6 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 495.07Molecular Weight (Monoisotopic): 494.2125AlogP: 6.80#Rotatable Bonds: 7
Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.36CX LogP: 7.08CX LogD: 7.04
Aromatic Rings: 4Heavy Atoms: 36QED Weighted: 0.28Np Likeness Score: -0.93

References

1.  (2004)  Calcium channel inhibitors comprising benzhydril spaced from piperazine, 

Source