The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9173869, 36 ID: ALA3946409
PubChem CID: 11656450
Max Phase: Preclinical
Molecular Formula: C27H24F4N4O2
Molecular Weight: 512.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCN(C(=O)Nc1cccc(C(F)(F)F)c1)C(C)c1nc2ccccc2c(=O)n1-c1ccc(F)cc1
Standard InChI: InChI=1S/C27H24F4N4O2/c1-3-15-34(26(37)32-20-8-6-7-18(16-20)27(29,30)31)17(2)24-33-23-10-5-4-9-22(23)25(36)35(24)21-13-11-19(28)12-14-21/h4-14,16-17H,3,15H2,1-2H3,(H,32,37)
Standard InChI Key: IQQSDTLYCQLASE-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 40 0 0 0 0 0 0 0 0999 V2000
5.1994 2.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1990 1.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8995 0.7554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 -0.7455 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6024 -2.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2991 3.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2978 -3.7529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.2529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 -6.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -7.2009 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.3026 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3002 -3.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 -1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2024 -2.6932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 -0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0994 -0.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3984 -1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3985 -2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0995 -3.7387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8004 -2.9887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0995 -5.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1384 -5.8402 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.0601 -5.8392 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.0990 -6.4395 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 9 1 0
14 15 1 0
15 16 2 0
15 17 1 0
17 7 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
21 23 1 0
23 24 2 0
24 18 1 0
4 25 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
32 34 1 0
34 35 1 0
34 36 1 0
34 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 512.51Molecular Weight (Monoisotopic): 512.1835AlogP: 6.55#Rotatable Bonds: 6Polar Surface Area: 67.23Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.11CX Basic pKa: 0.29CX LogP: 6.15CX LogD: 6.15Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.30Np Likeness Score: -1.73
References 1. (2015) Mediators of hedgehog signaling pathways, compositions and uses related thereto,