3-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-(4-methoxybenzylthio)quinazolin-4(3H)-one

ID: ALA3947042

PubChem CID: 134148015

Max Phase: Preclinical

Molecular Formula: C26H26N2O6S

Molecular Weight: 494.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(CSc2nc3cc(OC)c(OC)cc3c(=O)n2-c2ccc(OC)cc2OC)cc1

Standard InChI:  InChI=1S/C26H26N2O6S/c1-30-17-8-6-16(7-9-17)15-35-26-27-20-14-24(34-5)23(33-4)13-19(20)25(29)28(26)21-11-10-18(31-2)12-22(21)32-3/h6-14H,15H2,1-5H3

Standard InChI Key:  BAZROSOBVPIYPE-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   69.1907  -19.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.1896  -20.7479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.9044  -21.1607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.9026  -19.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.6180  -19.9169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.6187  -20.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.3340  -21.1547    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   72.0491  -20.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.0443  -19.9099    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   71.3284  -19.5027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7532  -19.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.4705  -19.9047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.1820  -19.4886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.1774  -18.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.4554  -18.2547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7469  -18.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.7651  -21.1496    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   72.7683  -21.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.4844  -22.3844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.4842  -23.2091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.1995  -23.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.9133  -23.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.9074  -22.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.1917  -21.9683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.3240  -18.6777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   75.6299  -23.6122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   76.3422  -23.1960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   68.4761  -19.5082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   72.0288  -18.2671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   72.0215  -17.4421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   68.4748  -21.1598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   68.4760  -18.6832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   67.7606  -20.7467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.8888  -18.2449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   75.6063  -18.6521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  9 11  1  0
  8 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
 10 25  2  0
 22 26  1  0
 26 27  1  0
  1 28  1  0
 16 29  1  0
 29 30  1  0
  2 31  1  0
 28 32  1  0
 31 33  1  0
 14 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3947042

    ---

Associated Targets(non-human)

DHFR Dihydrofolate reductase (644 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 494.57Molecular Weight (Monoisotopic): 494.1512AlogP: 4.72#Rotatable Bonds: 9
Polar Surface Area: 81.04Molecular Species: NEUTRALHBA: 9HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 4.86CX LogD: 4.86
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.08

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source