3-benzyl-6-chloro-2-(3,4,5-trimethoxybenzylthio)quinazolin-4(3H)-one

ID: ALA3947164

PubChem CID: 134147260

Max Phase: Preclinical

Molecular Formula: C25H23ClN2O4S

Molecular Weight: 482.99

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COc1cc(CSc2nc3ccc(Cl)cc3c(=O)n2Cc2ccccc2)cc(OC)c1OC

Standard InChI:  InChI=1S/C25H23ClN2O4S/c1-30-21-11-17(12-22(31-2)23(21)32-3)15-33-25-27-20-10-9-18(26)13-19(20)24(29)28(25)14-16-7-5-4-6-8-16/h4-13H,14-15H2,1-3H3

Standard InChI Key:  QJAIETSYFSRODY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   68.8922  -46.1714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   68.8910  -46.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.6058  -47.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.6040  -45.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.3194  -46.1678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.3202  -46.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.0355  -47.4056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   71.7505  -46.9908    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.7457  -46.1608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   71.0299  -45.7536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.4547  -45.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.4483  -44.9242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.4666  -47.4006    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   72.4698  -48.2255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.1859  -48.6353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.1857  -49.4600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.9009  -49.8697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.6148  -49.4544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.6089  -48.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.8931  -48.2192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.0255  -44.9286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   75.3314  -49.8631    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   76.0437  -49.4469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.1570  -44.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   73.1510  -43.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.4358  -43.2846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.7251  -43.7053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.7346  -44.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   68.1776  -45.7591    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   75.3203  -48.2073    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   73.9037  -50.6947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   75.3142  -47.3823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   74.6196  -51.1047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  1  0
 10  5  1  0
 12 11  1  0
  9 11  1  0
  8 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
 10 21  2  0
 18 22  1  0
 22 23  1  0
 12 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 12  1  0
  1 29  1  0
 19 30  1  0
 17 31  1  0
 30 32  1  0
 31 33  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3947164

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 482.99

Molecular Weight (Monoisotopic): 482.1067

AlogP: 5.42

#Rotatable Bonds: 8

Polar Surface Area: 62.58

Molecular Species: NEUTRAL

HBA: 7

HBD: ┄

#RO5 Violations: 1

HBA (Lipinski): 6

HBD (Lipinski): ┄

#RO5 Violations (Lipinski): 1

CX Acidic pKa: ┄

CX Basic pKa: 3.45

CX LogP: 5.85

CX LogD: 5.85

Aromatic Rings: 4

Heavy Atoms: 33

QED Weighted: 0.25

Np Likeness Score: -1.36

References

1. El-Messery SM, Hassan GS, Nagi MN, Habib EE, Al-Rashood ST, El-Subbagh HI..  (2016)  Synthesis, biological evaluation and molecular modeling study of some new methoxylated 2-benzylthio-quinazoline-4(3H)-ones as nonclassical antifolates.,  26  (19): [PMID:27554444] [10.1016/j.bmcl.2016.08.022]

Source

Source(1):

• Scientific Literature