US9475795, 78

ID: ALA3947348

PubChem CID: 86704293

Max Phase: Preclinical

Molecular Formula: C18H24ClN3O3S

Molecular Weight: 397.93

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(Cl)ccc1CC1CCN(S(=O)(=O)c2c(C)n[nH]c2C)CC1

Standard InChI:  InChI=1S/C18H24ClN3O3S/c1-12-18(13(2)21-20-12)26(23,24)22-8-6-14(7-9-22)10-15-4-5-16(19)11-17(15)25-3/h4-5,11,14H,6-10H2,1-3H3,(H,20,21)

Standard InChI Key:  ZUYOQHBOAKWQHG-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 26 28  0  0  0  0  0  0  0  0999 V2000
    3.6387   -0.8963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9072   -5.2404    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9020   -3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6004   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2096   -5.9864    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2465   -5.3824    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2052   -4.7864    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2157   -7.4872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0057   -8.3519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8651   -7.9789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4751   -9.7765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9751   -9.7704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4327   -8.3419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5702   -7.9596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  1  0
  5  7  2  0
  7  8  1  0
  8  9  2  0
  9  3  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 11  1  0
 14 17  1  0
 17 18  2  0
 17 19  2  0
 17 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  1  0
 25 20  2  0
 25 26  1  0
M  END

Associated Targets(Human)

PROKR1 Tchem Prokineticin receptor 1 (175 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 397.93Molecular Weight (Monoisotopic): 397.1227AlogP: 3.33#Rotatable Bonds: 5
Polar Surface Area: 75.29Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.99CX Basic pKa: 2.62CX LogP: 2.82CX LogD: 2.82
Aromatic Rings: 2Heavy Atoms: 26QED Weighted: 0.84Np Likeness Score: -1.76

References

1.  (2016)  Sulfonyl piperidine derivatives and their use for treating prokineticin mediated diseases, 

Source

Source(1):