US9187470, 62

ID: ALA3948841

PubChem CID: 72948632

Max Phase: Preclinical

Molecular Formula: C26H27N5O2

Molecular Weight: 441.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(Oc3ccncc3)cc2)cc1

Standard InChI:  InChI=1S/C26H27N5O2/c1-18-5-9-20(10-6-18)31-24(17-23(30-31)26(2,3)4)29-25(32)28-19-7-11-21(12-8-19)33-22-13-15-27-16-14-22/h5-17H,1-4H3,(H2,28,29,32)

Standard InChI Key:  RMRCQCSOOQOAQJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    2.3383   -1.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5987    1.5004    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9492    0.8772    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9546    1.9903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2067    3.2905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7390    2.9810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6216    3.9790    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9268    5.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0664    5.8243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8074    6.4482    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1126    7.9177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0048    8.9185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3032   10.3866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7286   10.8539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0398   12.3221    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4666   12.7876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7797   14.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2067   14.7170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3206   13.7123    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0075   12.2454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5806   11.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8460    9.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5380    8.3851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4444    1.8313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9314    0.7346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1510    2.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6377    1.7046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  5  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12  8  1  0
 12 13  1  0
 13 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 22  1  0
 20 28  1  0
 28 29  2  0
 29 17  1  0
 10 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
M  END

Associated Targets(Human)

MAPK13 Tchem MAP kinase p38 delta (2605 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 441.54Molecular Weight (Monoisotopic): 441.2165AlogP: 6.31#Rotatable Bonds: 5
Polar Surface Area: 81.07Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.48CX Basic pKa: 5.95CX LogP: 6.02CX LogD: 6.01
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.69

References

1.  (2015)  Anti-mucus drugs and uses therefor, 

Source

Source(1):