The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9187470, 62 ID: ALA3948841
PubChem CID: 72948632
Max Phase: Preclinical
Molecular Formula: C26H27N5O2
Molecular Weight: 441.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(Oc3ccncc3)cc2)cc1
Standard InChI: InChI=1S/C26H27N5O2/c1-18-5-9-20(10-6-18)31-24(17-23(30-31)26(2,3)4)29-25(32)28-19-7-11-21(12-8-19)33-22-13-15-27-16-14-22/h5-17H,1-4H3,(H2,28,29,32)
Standard InChI Key: RMRCQCSOOQOAQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9492 0.8772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9546 1.9903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2067 3.2905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7390 2.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6216 3.9790 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9268 5.4485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0664 5.8243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8074 6.4482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1126 7.9177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0048 8.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3032 10.3866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7286 10.8539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0398 12.3221 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4666 12.7876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7797 14.2546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2067 14.7170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3206 13.7123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0075 12.2454 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5806 11.7830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8460 9.8531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5380 8.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4444 1.8313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9314 0.7346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1510 2.8013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.6377 1.7046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
5 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 8 1 0
12 13 1 0
13 14 1 0
14 15 2 0
14 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 22 1 0
20 28 1 0
28 29 2 0
29 17 1 0
10 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.54Molecular Weight (Monoisotopic): 441.2165AlogP: 6.31#Rotatable Bonds: 5Polar Surface Area: 81.07Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.48CX Basic pKa: 5.95CX LogP: 6.02CX LogD: 6.01Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -1.69
References 1. (2015) Anti-mucus drugs and uses therefor,