The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US9394303, 56 ID: ALA3948966
PubChem CID: 118423394
Max Phase: Preclinical
Molecular Formula: C25H18FN3O4
Molecular Weight: 443.43
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(Cc2ccc(Oc3ccc(F)cc3)cc2)c2nc(-c3ccco3)cc(C(=O)O)c12
Standard InChI: InChI=1S/C25H18FN3O4/c1-15-23-20(25(30)31)13-21(22-3-2-12-32-22)27-24(23)29(28-15)14-16-4-8-18(9-5-16)33-19-10-6-17(26)7-11-19/h2-13H,14H2,1H3,(H,30,31)
Standard InChI Key: ZIXUWGGRHVYMNJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-0.4916 -3.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3114 -2.9665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8032 -3.1233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4133 -1.7530 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8794 -1.4442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8823 -2.5608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3506 -2.2538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3506 -3.3718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8824 -4.7969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8807 -5.9175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4102 -7.3427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4064 -8.4642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9332 -9.8877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4640 -10.1897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0855 -11.3284 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.4678 -9.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9409 -7.6448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4142 -5.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4142 -3.9859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 -1.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6387 -0.8963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 -2.6978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2121 3.8625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7463 5.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7537 5.2860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2149 3.8587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
14 16 1 0
16 17 2 0
17 11 1 0
9 18 1 0
18 19 2 0
19 6 1 0
4 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 1 0
25 26 2 0
25 27 1 0
24 28 2 0
28 2 1 0
28 20 1 0
22 29 1 0
29 30 1 0
30 31 1 0
31 32 2 0
32 33 1 0
33 29 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.43Molecular Weight (Monoisotopic): 443.1281AlogP: 5.68#Rotatable Bonds: 6Polar Surface Area: 90.38Molecular Species: ACIDHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.51CX Basic pKa: 1.78CX LogP: 4.67CX LogD: 1.44Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -1.67
References 1. (2016) Small molecule inhibitors of MCL-1 and uses thereof,