2-(3-chlorophenoxy)-N-(5-(N-thiazol-2-ylsulfamoyl)naphthalen-1-yl)acetamide

ID: ALA3949393

PubChem CID: 16102140

Max Phase: Preclinical

Molecular Formula: C21H16ClN3O4S2

Molecular Weight: 473.96

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(COc1cccc(Cl)c1)Nc1cccc2c(S(=O)(=O)Nc3nccs3)cccc12

Standard InChI:  InChI=1S/C21H16ClN3O4S2/c22-14-4-1-5-15(12-14)29-13-20(26)24-18-8-2-7-17-16(18)6-3-9-19(17)31(27,28)25-21-23-10-11-30-21/h1-12H,13H2,(H,23,25)(H,24,26)

Standard InChI Key:  VCBJKWQYJUIDFW-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   15.1567   -4.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1567   -5.5352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8645   -5.9468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.4531   -5.9468    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4531   -4.3127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.4531   -3.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7465   -3.0899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7465   -2.2785    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4505   -1.8708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1611   -2.2734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1611   -3.0877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0387   -1.8710    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.4489   -6.7618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1513   -7.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1513   -7.9811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4474   -8.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7367   -7.9861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7367   -7.1718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4474   -9.2078    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.1551   -9.6153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.1551  -10.4303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8750  -10.8478    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   15.6883  -11.6775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8753  -11.7619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5416  -10.9928    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.6302   -9.2078    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.0387   -9.9108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.8599   -8.3899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5610   -7.9794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5610   -7.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8591   -6.7631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  1  5  1  0
  5  6  1  0
  7  6  2  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
  6 11  1  0
  8 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 13 18  1  0
 16 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  1  0
 22 23  1  0
 23 24  2  0
 25 24  1  0
 21 25  2  0
 19 26  2  0
 19 27  2  0
 15 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 14 31  1  0
 31  3  1  0
M  END

Associated Targets(non-human)

Scn11a Voltage-gated sodium channel (36 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 473.96Molecular Weight (Monoisotopic): 473.0271AlogP: 4.77#Rotatable Bonds: 7
Polar Surface Area: 97.39Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 6.66CX Basic pKa: 0.59CX LogP: 4.15CX LogD: 3.55
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -2.25

References

1.  (2012)  Bicyclic derivatives as modulators of voltage gated ion channels, 

Source