US8999981, A21

ID: ALA3949655

PubChem CID: 91970535

Max Phase: Preclinical

Molecular Formula: C29H35FN6O2

Molecular Weight: 518.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C.CC1c2[nH]nc(NC(=O)c3ccccc3F)c2CN1C(=O)N1C[C@@H]2CCCN2C[C@@H]1Cc1ccccc1

Standard InChI:  InChI=1S/C28H31FN6O2.CH4/c1-18-25-23(26(32-31-25)30-27(36)22-11-5-6-12-24(22)29)17-34(18)28(37)35-16-20-10-7-13-33(20)15-21(35)14-19-8-3-2-4-9-19;/h2-6,8-9,11-12,18,20-21H,7,10,13-17H2,1H3,(H2,30,31,32,36);1H4/t18?,20-,21-;/m0./s1

Standard InChI Key:  JABOVKXLEZEDMF-DHMLMYTPSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    5.4992   -2.5362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2526   -1.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0317    0.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4979    1.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4959    2.1700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1816    3.6349    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2944    4.6420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4365    4.2737    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9795    6.1094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5511    6.5674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2335    8.0334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3442    9.0415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7726    8.5835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0903    7.1176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2330    6.7513    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.8683    1.5646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7167    0.0723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2524   -0.2436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6024   -2.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3115    2.9665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8032    3.1233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4133    1.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -3.0008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3039   -3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3092   -5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6108   -5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9072   -5.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9020   -3.7404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6004   -2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0194    1.5233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 15 16  1  0
  6 17  2  0
 17 18  1  0
 18 19  1  0
 19  2  1  0
 19  5  2  0
  3 20  1  0
 20 21  2  0
 20 22  1  0
 22 23  1  0
 24 23  1  1
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 24  1  0
 28 29  1  0
 29 30  1  0
 30 22  1  0
 30 31  1  1
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 32  1  0
M  END

Associated Targets(Human)

PRKCB Tchem Protein kinase C beta (4071 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 518.64Molecular Weight (Monoisotopic): 518.2806AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1.  (2015)  3-amido-pyrrolo[3,4-C]pyrazole-5(1H, 4H,6H) carbaldehyde derivatives, 

Source

Source(1):