The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA3949755
PubChem CID: 134147409
Max Phase: Preclinical
Molecular Formula: C21H21F3N6O2S
Molecular Weight: 478.50
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)N1CCCc2cccc(c2)Nc2ncc(C(F)(F)F)c(n2)NCc2cccnc21
Standard InChI: InChI=1S/C21H21F3N6O2S/c1-33(31,32)30-10-4-6-14-5-2-8-16(11-14)28-20-27-13-17(21(22,23)24)18(29-20)26-12-15-7-3-9-25-19(15)30/h2-3,5,7-9,11,13H,4,6,10,12H2,1H3,(H2,26,27,28,29)
Standard InChI Key: BGNMLKFHDPQLLJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
7.2126 -6.2838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4949 -6.6745 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.1921 -7.1007 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6400 -2.7074 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6389 -3.5270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3469 -3.9359 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0566 -3.5265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0537 -2.7038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3451 -2.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7572 -2.2926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3997 -1.9184 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.5566 -2.5931 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8903 -1.4491 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.7650 -3.9329 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1569 -4.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9738 -4.6692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3604 -5.3862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1766 -5.4057 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6025 -4.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2063 -3.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3914 -3.9717 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9303 -3.9358 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.9331 -6.0828 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.2134 -6.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2630 -7.4581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9233 -4.7504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2120 -5.1498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2047 -5.9637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9072 -6.3779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6186 -5.9723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6224 -5.1597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5183 -6.0402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7986 -6.4273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 12 1 0
10 13 1 0
8 10 1 0
7 14 1 0
14 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
17 23 1 0
5 22 1 0
23 24 1 0
23 2 1 0
2 25 1 0
22 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
24 32 1 0
32 33 1 0
33 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 478.50Molecular Weight (Monoisotopic): 478.1399AlogP: 3.96#Rotatable Bonds: 1Polar Surface Area: 100.11Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.36CX Basic pKa: 4.27CX LogP: 3.30CX LogD: 3.30Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -0.36
References 1. Farand J, Mai N, Chandrasekhar J, Newby ZE, Van Veldhuizen J, Loyer-Drew J, Venkataramani C, Guerrero J, Kwok A, Li N, Zherebina Y, Wilbert S, Zablocki J, Phillips G, Watkins WJ, Mourey R, Notte GT.. (2016) Selectivity switch between FAK and Pyk2: Macrocyclization of FAK inhibitors improves Pyk2 potency., 26 (24): [PMID:27876318 ] [10.1016/j.bmcl.2016.10.092 ]