The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-N-((S)-6-amino-1-((S)-2-carbamoylpyrrolidin-1-yl)-1-oxohexan-2-yl)-5-oxopyrrolidine-2-carboxamide ID: ALA3949875
Cas Number: 32467-84-8
PubChem CID: 11602800
Max Phase: Preclinical
Molecular Formula: C16H27N5O4
Molecular Weight: 353.42
Molecule Type: Protein
Associated Items:
Names and Identifiers Canonical SMILES: NCCCC[C@H](NC(=O)[C@@H]1CCC(=O)N1)C(=O)N1CCC[C@H]1C(N)=O
Standard InChI: InChI=1S/C16H27N5O4/c17-8-2-1-4-11(20-15(24)10-6-7-13(22)19-10)16(25)21-9-3-5-12(21)14(18)23/h10-12H,1-9,17H2,(H2,18,23)(H,19,22)(H,20,24)/t10-,11-,12-/m0/s1
Standard InChI Key: TXOZOKVIYFOVBE-SRVKXCTJSA-N
Molfile:
RDKit 2D
25 26 0 0 0 0 0 0 0 0999 V2000
8.0541 -15.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7686 -15.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4830 -15.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1976 -15.2875 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4830 -16.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0541 -16.5250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3397 -16.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7686 -16.9375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5864 -16.6071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0344 -17.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4469 -17.9347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2538 -17.7631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2138 -17.1340 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7686 -14.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9513 -15.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5034 -15.0049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0908 -14.2904 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2839 -14.4621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1251 -16.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5135 -16.9783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.9104 -16.6773 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0541 -14.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0541 -13.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3397 -12.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3397 -11.9874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
3 5 2 0
1 6 1 0
7 6 1 6
6 8 2 0
7 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 7 1 0
10 13 2 0
2 14 1 1
4 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 4 1 0
15 19 1 1
19 20 1 0
19 21 2 0
14 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 353.42Molecular Weight (Monoisotopic): 353.2063AlogP: -1.64#Rotatable Bonds: 8Polar Surface Area: 147.62Molecular Species: BASEHBA: 5HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.49CX Basic pKa: 10.17CX LogP: -2.81CX LogD: -5.23Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.39Np Likeness Score: -0.14
References 1. (2010) TRH-like peptide derivatives as inhibitors of the TRH-degrading ectoenzyme,