US9253997, 104

ID: ALA3950758

PubChem CID: 53374566

Max Phase: Preclinical

Molecular Formula: C10H12FN3O6S

Molecular Weight: 321.29

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  N[C@@H](CNC(=O)Nc1cc(S(=O)(=O)O)ccc1F)C(=O)O

Standard InChI:  InChI=1S/C10H12FN3O6S/c11-6-2-1-5(21(18,19)20)3-8(6)14-10(17)13-4-7(12)9(15)16/h1-3,7H,4,12H2,(H,15,16)(H2,13,14,17)(H,18,19,20)/t7-/m0/s1

Standard InChI Key:  FEKZHEXYUAZYQK-ZETCQYMHSA-N

Molfile:  

     RDKit          2D

 21 21  0  0  1  0  0  0  0  0999 V2000
    7.8024   -2.6887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8003   -1.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4990   -0.7409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2003   -1.4932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990   -0.7455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8969    0.4545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6003   -1.4977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -2.7000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.0008    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0388    3.6015    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0394    3.6005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0006    4.2008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0990   -0.7364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1394   -1.3343    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0969    0.4636    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
 13 14  1  0
 10 15  1  0
 15 16  2  0
 15 17  2  0
 15 18  1  0
  2 19  1  0
 19 20  2  0
 19 21  1  0
M  END

Associated Targets(Human)

CASR Tclin Calcium sensing receptor (766 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 321.29Molecular Weight (Monoisotopic): 321.0431AlogP: -0.39#Rotatable Bonds: 5
Polar Surface Area: 158.82Molecular Species: ZWITTERIONHBA: 5HBD: 5
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1
CX Acidic pKa: -2.52CX Basic pKa: 8.50CX LogP: -1.72CX LogD: -5.35
Aromatic Rings: 1Heavy Atoms: 21QED Weighted: 0.46Np Likeness Score: -1.38

References

1.  (2016)  Alkylamine derivative, 

Source

Source(1):